| Patents for A61P 33 - Antiparasitic agents (21,787) |
|---|
| 06/07/2006 | EP1666453A1 Methods of preparing substituted tetracyclines with transition metal-based chemistries |
| 06/07/2006 | EP1666060A1 Adjuvant systems and vaccines |
| 06/07/2006 | EP1666039A1 Use of L-alpha-lysophosphatidylcholine inhibitors to prevent inflammation |
| 06/07/2006 | EP1666028A1 Dry powder compositions having improved dispersivity |
| 06/07/2006 | EP1664124A2 Product comprising a c4bp core protein and a monomeric antigen, and its use |
| 06/07/2006 | EP1663131A1 Parasiticidal composition |
| 06/07/2006 | EP1663107A2 Rifamycin analogs and uses thereof |
| 06/06/2006 | US7056911 for example, N-[(2,4-diaminopteridin-6-yl)methyl]-9,10-dihydrodibenz[b,f]azepine; may be useful for treatment or prophylaxis of diseases associated with parasitic infection such as pneumocystis pneumonia, toxoplasmosis, cryptosporidiosis, leischmaniasis and malaria |
| 06/06/2006 | US7056895 1-(3,4-dihydroxy-5-methylol-tetrahydrofur-2-yl),3-amidino-1H-1,2,4- triazoles; infections, infestations, autoimmune diseases; anticarcinogenic and -tumor agents; HIV, hepatitis C, human papilloma virus and giant cell arteritis |
| 06/06/2006 | US7056518 Malarial pre-erythrocytic stage polypeptide molecules |
| 06/06/2006 | US7056501 used to develop diagnostic assays for the detection of Neospora infections in cattle and other animals |
| 06/06/2006 | CA2457852C Multivesicular emulsion topical delivery systems |
| 06/01/2006 | WO2003025542A3 Immune response associated proteins |
| 05/31/2006 | EP1420644B1 Substituted propargylamines |
| 05/31/2006 | EP1352061B1 Method for inhibiting the expression of a target gene |
| 05/31/2006 | EP1263467B1 Paste formulations comprising silica |
| 05/31/2006 | EP1165073B1 Combination of antibiotic and nucleic acid binding compound for bacterial antibiotic resistance |
| 05/31/2006 | CN1778388A Young schistosomiasis cell style vaccine for preventing from schistosomiasis disease |
| 05/31/2006 | CN1778198A Food with body insect repellant function |
| 05/31/2006 | CN1257718C Chinese traditional medicine composition and its preparation and quality control method thereof |
| 05/30/2006 | US7053192 Crystal forms of azithromycin |
| 05/30/2006 | US7053098 3,4-Dihydro-(1H) quinazolin-2-one compounds as CSBP/P38 kinase inhibitors |
| 05/30/2006 | US7052707 Pharmaceutical composition containing aminoacetonitril compounds and the use thereof for the preparation of a pharmaceutical composition for the treatment of endoparasitic pests in animals |
| 05/30/2006 | CA2391659C Crystal forms of azithromycin |
| 05/30/2006 | CA2237594C Fused imidazole derivatives as multidrug resistance modulators |
| 05/26/2006 | WO2006054947A1 Novel antimicrobial peptides |
| 05/26/2006 | WO2006053641A1 Prevention of vertical endoparasite infections |
| 05/26/2006 | CA2588145A1 Novel antimicrobial peptides |
| 05/25/2006 | US20060111323 Use of polysiloxanes having quaternary ammonium groups as formulation auxiliaries, and compositions comprising them |
| 05/25/2006 | US20060111280 Novel substance fki-1033 and process for producing the same |
| 05/24/2006 | EP1658074A1 Inhibitors of 2-oxoglutarate dioxygenase as gamma globin inducers |
| 05/24/2006 | EP1333841B1 M. tuberculosis chaperonin 10 and uses thereof |
| 05/24/2006 | EP1141305B1 Chimeric gene encoding the antigenic determinants of four proteins of l. infantum |
| 05/24/2006 | DE19543271B4 Orales pharmazeutisches Präparat An oral pharmaceutical composition |
| 05/24/2006 | CN1777595A Derivatives of dioxane-2-alkyl carbamates, preparation thereof and application thereof in therapeutics |
| 05/24/2006 | CN1256948C Avermectin containing parasite resisitant long-acting injection |
| 05/23/2006 | US7049439 Immunomodulators for inducing cytokine biosynthesis; viricides; antitumor agents |
| 05/23/2006 | US7049322 Compositions and formulations of 9-nitrocamptothecin polymorphs and methods of use therefor |
| 05/23/2006 | US7049315 Solubilized topoisomerase poisons |
| 05/23/2006 | US7049311 Pyrrolbenzodiazepines |
| 05/23/2006 | US7048937 Methods and compositions for control of coccidiosis |
| 05/18/2006 | WO2006053160A2 Methods and compositions using immunomodulatory compounds for treatment and management of parasitic diseases |
| 05/18/2006 | WO2006050826A2 Treatment of mastitis with enrofloxacin |
| 05/18/2006 | US20060105998 Antiprotozoal ring-substiuted phospholipids |
| 05/18/2006 | US20060105990 Uronic acid-terminated carbohydrate having a double bond between the C4 and C5 atom of the uronic acid a maximum degree of polymerization of 100, combined with a mixture of two different undigestable prebiotic carbohydrates; blocking the adhesion of pathogens or toxins to eucariotic cells |
| 05/18/2006 | US20060105969 Anthelmintic compositions |
| 05/18/2006 | US20060105048 Remedy |
| 05/18/2006 | CA2586950A1 Methods and compositions using immunomodulatory compounds for treatment and management of parasitic diseases |
| 05/17/2006 | EP1656936A1 Macrophage activation inhibitor |
| 05/17/2006 | EP1538905A4 High concentration topical insecticide containing pyriproxyfen |
| 05/17/2006 | EP1387660A4 Use of 3-position cyclosporin derivatives for hair growth |
| 05/17/2006 | EP1113818B1 METHODS OF TREATING IgE-ASSOCIATED DISORDERS AND COMPOSITIONS FOR USE THEREIN |
| 05/17/2006 | CN1772726A Halofantrine preparing method |
| 05/17/2006 | CN1772299A The pIL-4 gene adjuvant for pig vaccine and its prepn process |
| 05/17/2006 | CN1772298A The pIL-6 gene adjuvant for pig vaccine and its prepn process |
| 05/17/2006 | CN1772297A The pIFN-gamma gene adjuvant for pig vaccine and its prepn process |
| 05/17/2006 | CN1772066A New use of peach tree in killing bacteria, killing pest, detoxicating, treating disease and preserving health |
| 05/17/2006 | CN1771936A Stable medicine composition of artemisinin or its derivative |
| 05/17/2006 | CN1256109C Protective agent preparing by manioca seed for preventing japanese blood fluke infection |
| 05/16/2006 | US7045509 Proteins and nucleic acids encoding same |
| 05/11/2006 | WO2006048734A1 Treatment of parasitic infections in humans and animals |
| 05/11/2006 | WO2006029887A3 Vaccines comprising plasmodium antigens |
| 05/11/2006 | US20060100142 Use of uk114 in the treatment of leishmaniasis |
| 05/11/2006 | US20060099197 identifying a mammalian subject having an infection with said pathogenic Clostridium bacterium resistant to antibiotic, orally administering a therapeutically-effective concentration of Bacillus coagulans bacteria; reducing gastrointestinal colonization by a pathogenic Clostridium bacterium |
| 05/11/2006 | US20060099174 Interferon-alpha induced genes |
| 05/11/2006 | US20060099150 Compositions and methods for the transport of biologically active agents across cellular barriers |
| 05/10/2006 | EP1655302A2 Antiparasitic artemisinin derivatives (endoperoxides) |
| 05/10/2006 | EP1654244A1 3-aryl-4-hydroxyfuranone compounds and pharmaceutical and veterinary compositions containing them |
| 05/10/2006 | EP1653997A1 Methods and compositions for controlling ectoparasites |
| 05/10/2006 | EP1483374B1 Use of l-alpha-lysophosphatidycholine to obtain the differentiation of monocytes in mature dendritric cells in vitro |
| 05/10/2006 | EP1418911B1 2,4,5-trisubstituted thiazolyl derivatives and their antiinflammatory activity |
| 05/10/2006 | CN1771254A Process for preparing inhibitors of nucleoside phosphorylases and nucleosidases |
| 05/10/2006 | CN1771233A Process for resolving aimines that are useful for the treatment of disorders associated with insulin resistance syndrome. |
| 05/10/2006 | CN1771215A Antimicrobial trinervitane derivatives |
| 05/10/2006 | CN1768755A Arteannuin and arteannuin derivative oral disintegrating tablet |
| 05/10/2006 | CN1768742A Intravenous formulation of ornidazole and its preparation method |
| 05/10/2006 | CN1255106C Complex artemisia apiacea extract |
| 05/10/2006 | CN1255101C Antibacterial disinfectant for cracking DNA of bacteria |
| 05/09/2006 | US7041813 Canine herpes virus alpha transinducing factor nucleic acid molecules |
| 05/04/2006 | WO2006047756A2 Substituted tetracycline compounds |
| 05/04/2006 | WO2006032525A3 Combinational therapy for treating cancer |
| 05/04/2006 | US20060093627 Method of protecting chronic infections |
| 05/04/2006 | US20060093612 Use of heat shock proteins to enhance efficacy of antibody therapeutics |
| 05/04/2006 | CA2585248A1 Substituted tetracycline compounds |
| 05/03/2006 | EP1572665B1 1-n-phenylamino-1h-imidazole derivatives as aromatase inhibitors |
| 05/03/2006 | EP1528923B1 N-((3-oxo-2,3-dihydro-1h-isoindol-1-yl)acetyl)guanidine derivatives as nhe1-inhibitors for the treatment of infarction and angina pectoris |
| 05/03/2006 | EP1465870B1 Substituted 4-phenyltetrahydroisoquinolinium salts, method for production and use thereof as a medicament and medicaments comprising the same |
| 05/03/2006 | EP1242400B1 Pyrrolidine derivatives as cyclic amp-specific phosphodiesterase inhibitors |
| 05/03/2006 | EP1232748B1 Use of substituted nitrobenzene derivatives for the treatment of diseases caused by bacteria, fungi and viruses |
| 05/03/2006 | EP1104309B1 Co-lyophilized complex comprising a nucleic acid vector and a formulating agent |
| 05/03/2006 | CN1765410A Chinese medicinal lotion |
| 05/02/2006 | US7038051 Imidazonaphthyridines |
| 05/02/2006 | US7037718 Mutant purine nucleoside phosphorylase proteins and cellular delivery thereof |
| 05/02/2006 | US7037665 Compositions comprising SNORF36 receptor compounds |
| 04/27/2006 | US20060089400 Novel spiro ketone and carboxylic acid derivatives as specific inhibitors for (po3h2) ser/(po3h2)thr-pro-specific peptidyl-prolylcis/trans-isomerases |
| 04/27/2006 | US20060089393 Heteroaryl substituted biphenyl derivatives as p38 kinase inhibitors |
| 04/27/2006 | US20060089379 Tetrahydropyranyl cyclopentyl tetrahydroisoquinoline modulators of chemokine receptor activity |
| 04/27/2006 | US20060089345 Indole derivatives, method for preparating same and pharmaceutical compositions containing same |
| 04/27/2006 | US20060089326 Immunostimulatory nucleic acid molecules |
| 04/27/2006 | US20060088546 Antigens for raising an immune response against rickettsieae and ehrlichieae pathogens |