| Patents for A61P 33 - Antiparasitic agents (21,787) |
|---|
| 09/08/2004 | CN1165538C Tert-butoxy carbonyl dihydro artemisinin, preparation method and drug composition thereof |
| 09/08/2004 | CN1165338C Endoparasiticidal compositions |
| 09/08/2004 | CN1165300C Parenteral paclitaxel stable non-toxic formulation |
| 09/08/2004 | CN1165289C Veterinary formulation for administration of a water-insoluble drug to a target animal through a water distribution system |
| 09/07/2004 | US6787342 Paste formulations |
| 09/07/2004 | CA2174645C Polycyclic antiparasitic agents, process and strain for their preparation and their use |
| 09/02/2004 | WO2004074272A1 Anthelmintic agents and insecticidal compositions |
| 09/02/2004 | WO2004062645B1 Microspheres containing amphotericin b |
| 09/02/2004 | WO2002092589A3 Novel decalactones from associated fungi of marine sponges and their synthetic derivatives as medicaments |
| 09/02/2004 | US20040171804 for drug screening cancer, osteoporosis, obesity, Alzheimer's disease drugs; genetic engineering; kits |
| 09/02/2004 | US20040171650 Fighting parasitic infections in human and animals; 1,2,4-triazol-3-thioyl derivatives |
| 09/02/2004 | US20040171617 treatment for disorders and diseases, such as chronic inflammation, tissue breakdown and cancer |
| 09/02/2004 | US20040171123 fusion protein of an antibody that binds to human epidermal growth factor receptor-2 (HER2) and albumin with long shelf-life; stabilizing therapeutic proteins such as antibodies by conjugating them to albumin |
| 09/02/2004 | US20040171012 Nucleic acid-associated proteins |
| 09/02/2004 | US20040170999 Nuclear hormone receptor ligand binding domain |
| 09/02/2004 | US20040170649 uses optimal solvent systems such that the lipid envelope around the viral particle is dissolved while the viral particle remains intact; autologous vaccines |
| 09/02/2004 | US20040170620 Selected antibody compositions for binding to aminophospholipids |
| 09/02/2004 | CA2516748A1 Anthelmintic agents and insecticidal compositions |
| 09/01/2004 | EP1452522A2 Novel compounds and compositions as protease inhibitors |
| 09/01/2004 | EP1452184A1 Use of thioester-containing proteins (TEPs) for triggering/inducing an immune response in mosquitoes of Anopheles against plasmodium malariae |
| 09/01/2004 | EP1452183A1 Use of PGRP, LRRP and CTL proteins to trigger an anti-Plasmodium immune response in Anopheles species |
| 09/01/2004 | EP1451329A2 Genetic vaccine against human immunodeficiency virus |
| 09/01/2004 | EP1451308A2 Therapeutic use of aziridino compounds |
| 09/01/2004 | EP1451191A1 Thioether substituted imidazoquinolines |
| 09/01/2004 | EP1451187A1 Amide substituted imidazopyridines |
| 09/01/2004 | EP1451186A2 Urea substituted imidazopyridines |
| 09/01/2004 | EP1450856A2 Packaging of immunostimulatory substances into virus-like particles: method of preparation and use |
| 09/01/2004 | EP1450854A2 Vaccine |
| 09/01/2004 | EP1450821A1 Immunostimulatory oligodeoxynucleotides |
| 09/01/2004 | EP1450803A1 New uses for anti-malarial therapeutic agents |
| 09/01/2004 | EP1089745B1 Oregano for the treatment of internal parasites and protozoa |
| 09/01/2004 | EP1047769B1 Novel therapeutic uses of heterologous superoxide dismutase (hsd), and method for selecting said hsd |
| 09/01/2004 | EP0984955B1 Substituted 2-(2,6-dioxopiperidin-3-yl)-phthalimides and 1-oxoisoindolines and method of reducing tnf alpha levels |
| 09/01/2004 | CN1526017A Gene associated with leishmania parasite virulence |
| 09/01/2004 | CN1525954A Novel compounds as anti-inflammatory, immunomodulatory and anti-proliferatory agents |
| 09/01/2004 | CN1524583A Use of gene for expressing Notch-ligand in production of medicinal preparations for immunotherapy |
| 08/31/2004 | US6783977 Internal ribosome entry site and vector containing same |
| 08/31/2004 | CA2293397C C-4''-substituted macrolide derivatives |
| 08/26/2004 | WO2004072086A2 Antiparasitic terpene alkaloids |
| 08/26/2004 | WO2004072070A1 Antiproliferative 2-(sulfo-phenyl)-aminothiazole derivatives |
| 08/26/2004 | US20040167334 Heterocyclic acylsulfimides, processes for their preparation, compositions comprising them and their use as pesticides |
| 08/26/2004 | US20040167162 therapy for infection of adenovirus, rhinovirus ; using an (amino or hydroxy)quinoline compound |
| 08/26/2004 | US20040167089 Immunostimulatory nucleic acid molecules |
| 08/26/2004 | US20040167034 Emulsion and dispersion formulations and method |
| 08/26/2004 | CA2515728A1 Antiproliferative 2-(sulfo-phenyl)-aminothiazole derivatives |
| 08/25/2004 | EP1449435A1 Anthelmintic composition |
| 08/25/2004 | EP1448564A2 Substituted indolizine-like compounds and methods of use |
| 08/25/2004 | EP1448550A1 Nitrogenous tetrahydropyridyl-alkyl-heterocycles with tnf activity |
| 08/25/2004 | EP1448535A1 Benzamide and heteroarylamide as p2x7 receptor antagonists |
| 08/25/2004 | EP1448513A1 Biphenyl-derivatives as p38-kinase inhibitors |
| 08/25/2004 | EP1448179A1 Substituted bicyclo 3.3.1 nonan-2,4,9-triones as pharmaceutical active ingredients |
| 08/25/2004 | EP1448151A1 Dosage form, device and methods of treatment |
| 08/25/2004 | EP1448127A1 Compositions for the treatment of infectious diseases |
| 08/25/2004 | EP1448052A1 Anti-pathogenic composition useful in blood preservation |
| 08/25/2004 | CN1523017A Oxfendazole chloride preparation and uses |
| 08/25/2004 | CN1522706A Preparation of solid dispersoid containing large ring lactone parasite medicine |
| 08/25/2004 | CN1522704A Parasite resistant slow release injection formulation for animals |
| 08/24/2004 | US6780876 Composition for keeping away vermin |
| 08/24/2004 | US6780628 Enzyme treatment |
| 08/19/2004 | WO2004069874A1 Monoclonal antibodies against the ring surface protein 2 (rsp-2) antigen of plasmodium falciparum |
| 08/19/2004 | WO2004069856A1 Process for preparing inhibitors of nucleoside phosphorylases and nucleosidases |
| 08/19/2004 | WO2004069852A1 Avermectins substituted in the 4” and 4’-positions having pesticidal properties |
| 08/19/2004 | WO2004069806A2 Substituted 2-aminoimidazoles, method for the production thereof, their use as a medicament or as a diagnostic reagent, and medicament containing these compounds |
| 08/19/2004 | WO2004069778A1 Antimicrobial trinervitane derivatives |
| 08/19/2004 | WO2004069242A1 Anthelmintic composition |
| 08/19/2004 | WO2004056828A3 Novel compounds and uses thereof |
| 08/19/2004 | WO2004019912A3 Buccal, polar or non-polar spray or capsule containing drugs for treating an infectious disease or cancer |
| 08/19/2004 | WO2003093258A3 Novel spiro ketone and carboxylic acid derivatives as specific inhibitors for (po3h2) ser/(po3h2)thr-pro-specific peptidyl-prolyl-cis/trans-isomerases |
| 08/19/2004 | US20040162283 Acyclic and cyclic guanidine-and acetamidine derivatives, their preparation and their use as pesticides, esp. as parasiticides |
| 08/19/2004 | US20040161441 Containing permethrin, imidacloprid and n-methylpyrrolidone; killing ticks and fleas; skin friendly, low toxicity; storage stability |
| 08/19/2004 | US20040161428 Such as transferrin-doxorubicin conjugate linked by gluteraldehyde; inexpensive, effective |
| 08/19/2004 | DE10237722A1 Indol- oder Benzimidazolderivate zur Modulation der IKappaB-Kinase Indole or benzimidazole derivatives for the modulation of IkappaB kinase |
| 08/19/2004 | CA2514028A1 Substituted 2-aminoimidazoles, method for the production thereof, their use as a medicament or as a diagnostic reagent, and medicament containing these compounds |
| 08/18/2004 | EP1446391A2 Preparation and use of carbohydrate-based ring structures with antimicrobial and cytostatic activity |
| 08/18/2004 | EP1446386A1 Benzimidazol- or indol-aminoacetonitrile derivatives for parasite control |
| 08/18/2004 | EP1446375A1 Dihalogenpropene compounds, method for the production thereof, agents containing said compounds and the use thereof as pest control agents |
| 08/18/2004 | EP1446108A2 Methods and reagents for the control of infestations of parasites |
| 08/18/2004 | EP1268429B1 Vitronectin receptor antagonist bicyclic compounds, preparation method and compositions containing same |
| 08/18/2004 | CN1522158A Treatment of parasitic disease |
| 08/18/2004 | CN1520822A Novel compound antimalarial preparation method |
| 08/18/2004 | CN1520816A Sophocarpidine gel preparation and its process |
| 08/17/2004 | US6777543 13-methyl erythromycin derivatives |
| 08/17/2004 | US6777448 Rafoxanide, for the treatment of parasitic diseases in farm and domestic animals, like the liver fluke or bot fly infestations |
| 08/17/2004 | US6777402 Acidic alcoholysis of biological raw material giving crystalline alkyl pheophorbide; conversion of alkyl pheophorbide into an acidic porphyrin; reaction of the acidic porphyrin with a hydrophylic organic amine |
| 08/17/2004 | US6777393 Bacterial and protozoa infections in mammals, fish and birds |
| 08/17/2004 | US6777192 Contacting the sample with an isolated recombinant immunodominant neospora antigen, forming an antigen/antibody complex, and detecting the presence or absence of the complex |
| 08/12/2004 | WO2004067543A1 Avermectin and avermectin monosaccharide derivatives substituted in the 4”- or 4’-position having pesticidal properties |
| 08/12/2004 | WO2004067514A1 3,3-dimethyl-8-oxoisoquinolines for medical purposes, methods for the production thereof, medicaments containing said compounds and the use of the same |
| 08/12/2004 | WO2004067040A1 Gene vaccine against intracellular parasite |
| 08/12/2004 | WO2004066725A2 Avermectin- and avermectin monosaccharide derivatives substituted in the 4”- or 4’-position having pesticidal properties |
| 08/12/2004 | WO2004050092B1 Use of canthin-6-one, plant extracts containing same and derivatives thereof in the treatment of trypanosomiases |
| 08/12/2004 | WO2004022032A3 Pharmaceutical dosage form comprising a sulfite compound |
| 08/12/2004 | WO2004009068A3 Compounds with antiparasitic activity and medicines containing same |
| 08/12/2004 | WO2003093231A3 Tetrahydropyranyl cyclopentyl tetrahydroisoquinoline modulators of chemokine receptor activity |
| 08/12/2004 | WO2003029293A3 Modulators of notch ic protease activity for use in immunotherapy |
| 08/12/2004 | US20040158092 for example, N-(N-acetyl-L-cysteinyl)-S-acetylcysteamine; by protecting the N-acyl-L-cysteine to form an intermediate compound and then coupling intermediate compound with S-acylcysteamine hydrochloride or with thiazolidine |
| 08/12/2004 | US20040157924 Novel methods for using alkanoyloxymethyl esters |
| 08/12/2004 | US20040157828 Protease inhibitors |
| 08/12/2004 | US20040157307 for treating a patient with cancer comprising a cancer-specific antigen or a nucleic acid encoding the protein to the patient; genetic engineering; drug delivery; kits |
| 08/12/2004 | US20040156899 Formulation of an erodible, gastric retentive oral dosage form using in vitro disintegration test data |