| Patents for A61P 31 - Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics (179,784) |
|---|
| 05/03/2006 | EP1089738B1 Antimicrobial compositions comprising taurolidine, citric acid and sodium citrate |
| 05/03/2006 | EP1056459B1 Treatment of hiv infections |
| 05/03/2006 | EP1015481B1 Antigenic structural peptide, antigenic and immunogenic compounds and uses for detecting, preventing and treating an hcv infection |
| 05/03/2006 | CN1768140A A high-troughput diagnostic assay for the human virus causing severe acute respiratory syndrome (SARS) |
| 05/03/2006 | CN1768079A Polypeptide |
| 05/03/2006 | CN1768040A Isoquinoline-5-sulfonic acid amides as inhibitors of AKT (protein kinase B) |
| 05/03/2006 | CN1767870A Otorhinological delivery device |
| 05/03/2006 | CN1767853A Mucosal meningococcal vaccines |
| 05/03/2006 | CN1767847A Treatment of aspergillus infections with thymosin alpha 1 |
| 05/03/2006 | CN1767845A Composition for treating hepatitis c |
| 05/03/2006 | CN1767843A Method for preparing antimicrobial agent and antioxidant position from sea-buckthorn seeds |
| 05/03/2006 | CN1767839A Antiallergic composition |
| 05/03/2006 | CN1767821A Drug composition with antimicrobial activity |
| 05/03/2006 | CN1767819A Solid pharmaceutical compositions comprising a S1P receptor agonist and a sugar alcohol |
| 05/03/2006 | CN1766110A Miniaturized Staphylococcus aureus polypeptide of against drug resistance and its uses and preparation method |
| 05/03/2006 | CN1765894A Novel flavane derivative and its preparation method and uses |
| 05/03/2006 | CN1765887A Preparation method of imidazole aromatic alcohol analog derivative with optical activity |
| 05/03/2006 | CN1765884A Antimycotic compound and its preparation method and uses |
| 05/03/2006 | CN1765418A REV(reticuloendotheliosis virus) subunit vaccine and its production method |
| 05/03/2006 | CN1765410A Chinese medicinal lotion |
| 05/03/2006 | CN1765394A Beriberi treating medicine |
| 05/03/2006 | CN1765370A Method for preparing anti-aftosa serum |
| 05/03/2006 | CN1765369A Nano silver gel and its use |
| 05/03/2006 | CN1765368A Anti-infection nano montmorillonite and its preparation method |
| 05/03/2006 | CN1765360A Long acting(sustained-release) amoxilin capsule and preparation method thereof |
| 05/03/2006 | CN1254542C Methods for the recombinant production of antifusogenic peptides |
| 05/03/2006 | CN1254473C Process for crystallization of(R)-or(S)-lansoprazole |
| 05/03/2006 | CN1254471C Substituted benzopyran anti-fungus compound |
| 05/03/2006 | CN1254272C Activation and inhibition of immune system |
| 05/03/2006 | CN1254271C Hybrid polypeptides with enhanced pharmacokinetic properties |
| 05/03/2006 | CN1254266C Capsule for treating coryza and its preparation method |
| 05/03/2006 | CN1254262C Compound cold-treating tablet and its manufacturing method |
| 05/03/2006 | CN1254258C Method for treating bacterial infection-type dermatopath and its preparing process |
| 05/03/2006 | CN1254247C Antibiotic action enhancing medicinal composition |
| 05/03/2006 | CN1254244C Balofoxacin liquid preparation ,preparing method and its use |
| 05/03/2006 | CN1254242C Anti-infectious medicine composition and pharmaceutical use thereof |
| 05/03/2006 | CN1254240C Silibinin meglumine salt oral disintegration tablet and its preparing method |
| 05/03/2006 | CN1254199C Multi-purpose high-function alkaline solution composition, its preparing process and its usage as non-specific immanopotentiator |
| 05/02/2006 | US7038073 Synthesis of 2-alkyl amino acids |
| 05/02/2006 | US7038051 Imidazonaphthyridines |
| 05/02/2006 | US7038035 Nucleic acids codes polypeptides; mutants; insertion a vector; culturing; recovering |
| 05/02/2006 | US7038029 Vaccination |
| 05/02/2006 | US7037929 2-amino-thiazole derivatives, process for their preparation, and their use as antitumor agents |
| 05/02/2006 | US7037917 Nitrogen compounds such as 4-((4-amino-5-bromo-6-(4-cyano-2,6-dimethylphenyloxy)-2 -pyrimidinyl)amino)benzonitrile, used as protease inhibitors for prophylaxis of viral diseases |
| 05/02/2006 | US7037896 HIV inhibiting peptide (VIRIP) and amidated, acetylated, sulfated, polyethylene glycol modified, phosphorylated and/or glycosylated derivatives |
| 05/02/2006 | US7037718 Mutant purine nucleoside phosphorylase proteins and cellular delivery thereof |
| 05/02/2006 | US7037685 Nucleotide sequence coding polypeptide for use in the treatment and prevent of viral diseases, infections and tumors |
| 05/02/2006 | US7037665 Compositions comprising SNORF36 receptor compounds |
| 05/02/2006 | US7037523 Controlled release compositions for macrolide antimicrobial agents |
| 05/02/2006 | US7037509 Immunologically significant herpes simplex virus antigens and methods for using same |
| 05/02/2006 | US7037508 Pestivirus mutants and vaccines containing the same |
| 05/02/2006 | US7037506 Vaccine accelerator factor (VAF) for improvement of vaccinations in poultry |
| 05/02/2006 | US7037503 Compounds and methods for the treatment and prevention of bacterial infection |
| 05/02/2006 | US7037495 Antimicrobial compositions |
| 05/02/2006 | CA2486475A1 Method of treating microorganisms in the oral cavity |
| 05/02/2006 | CA2198010C 4-(2-amino-6-(cyclopropylamino)-9h-purin-9-yl)-2-cyclopentene-1-methanol succinate as antiviral agent |
| 05/02/2006 | CA2184375C Oligonucleotide n3'-p5' phosphoramidates: synthesis and compounds; hybridization and nuclease resistance properties |
| 04/27/2006 | WO2006045006A1 Antibiotic product formulation |
| 04/27/2006 | WO2006044968A2 Combination therapy for treating viral infections |
| 04/27/2006 | WO2006044582A2 Use of baff to treat sepsis |
| 04/27/2006 | WO2006044410A2 A32 monoclonal antibody fusion proteins for use as hiv inhibitors and vaccines |
| 04/27/2006 | WO2006044379A2 Novel curcumin analogues and uses thereof |
| 04/27/2006 | WO2006043722A1 Chimeric (double) decoy |
| 04/27/2006 | WO2006043671A1 TRANSCRIPTIONAL FACTOR Nrf2 ACTIVATOR AND FOOD HAVING THE FUNCTION OF THE SAME IMPARTED THERETO |
| 04/27/2006 | WO2006043615A1 Use of immunesuppressant receptor |
| 04/27/2006 | WO2006043153A2 Use of zinc and copper chelators for the treatment of viral diseases |
| 04/27/2006 | WO2006043145A1 Inhibitors of hepatitis c virus protease, and compositions and treatments using the same |
| 04/27/2006 | WO2006042858A2 Complex comprising an antibiotic, a cyclodextrin and an interaction agent |
| 04/27/2006 | WO2006042654A1 Substituted nonadepsipeptides |
| 04/27/2006 | WO2006042653A1 Heterocyclyl-substituted nonadepsipeptides |
| 04/27/2006 | WO2006042634A1 4-aminophenyl morpholinone derivatives for the treatment of hepatitis c |
| 04/27/2006 | WO2006042479A1 Pharmaceutical composition and non dependence coffee comprising edible carboxylic acid and/or its acid salt and coffeine |
| 04/27/2006 | WO2006042478A1 Small-molecule inhibitors of coronaviral main protease, their preparation and use |
| 04/27/2006 | WO2006042418A1 Antiviral oligonucleotides |
| 04/27/2006 | WO2006005581A3 A composition comprising a pharmacologically active agent coupled to a target cell specific component, and a saponin |
| 04/27/2006 | WO2006002927A3 Medium chain fatty acids applicable as anti-microbial agents |
| 04/27/2006 | WO2005101004A3 Diagnostics and therapeutics for diseases associated with purinoceptor 1 type y (p2y1) |
| 04/27/2006 | WO2005092365A3 Pharmaceutical use of novispirins |
| 04/27/2006 | WO2005027847A3 Antibodies for use against sars |
| 04/27/2006 | WO2003040333A3 Methods for inhibiting proliferation of astrocytes and astrocytic tumor cells and for enhancing survival of neurons and uses thereof |
| 04/27/2006 | US20060089498 3-amino-2-ethoxycarbonylpyrrole; chemical intermediate in synthesis of 3H,5H-pyrrolo[3,2-d]pyrimidin-4-one; a convergent synthesis route rather than a linear one |
| 04/27/2006 | US20060089400 Novel spiro ketone and carboxylic acid derivatives as specific inhibitors for (po3h2) ser/(po3h2)thr-pro-specific peptidyl-prolylcis/trans-isomerases |
| 04/27/2006 | US20060089393 Heteroaryl substituted biphenyl derivatives as p38 kinase inhibitors |
| 04/27/2006 | US20060089363 Antibacterial agents |
| 04/27/2006 | US20060089345 Indole derivatives, method for preparating same and pharmaceutical compositions containing same |
| 04/27/2006 | US20060089344 E.g., 2-(Methylamino)-2-oxoethyl 3-[1-(1-isoquinolyl)-4-piperidyl]propylcarbamate hydrochloride and 3{2-[1-(2-quinolyl)-4-piperidyl]-ethyl}-1,3-oxazolidine-2,4-dione; preventing or treating a pathology in which endogenous cannabinoids and/or any other substrate metabolized by the enzyme FA; analgesics |
| 04/27/2006 | US20060089334 Aminoalkylphosphonates and related compounds as edg receptor agonists |
| 04/27/2006 | US20060089326 Immunostimulatory nucleic acid molecules |
| 04/27/2006 | US20060089312 Protease inhibitors |
| 04/27/2006 | US20060089310 Treatment of infections and other disorders |
| 04/27/2006 | US20060089298 Novel substances k01-b0171 and process for producing the same |
| 04/27/2006 | US20060088933 Immunogenic label for detection of low concentrations of viral therapeutics/antibodies in blood; diagnosing/detecion/monitoring viral drug resistance; immunoassay |
| 04/27/2006 | US20060088824 Used in assays to identify PAP-1/WIP-1 interaction inhibitors; West Nile virus (WNV) |
| 04/27/2006 | US20060088561 solidifying agent consists of long chain fatty alcohol; carrier is semi-solid at rest and liquefies upon application of shear forces |
| 04/27/2006 | US20060088553 Medicament for the treatment of diseases due to infection by neisseria meningitidis |
| 04/27/2006 | US20060088540 Antagonists and methods for inhibiting angiogenesis |
| 04/27/2006 | US20060088520 Antigen presenting cell targeting conjugate, an antigen presenting cell contacted with such conjugate, their use for vaccination or as medicament, and methods for their production or generation |
| 04/27/2006 | US20060088513 Antiallergic composition |
| 04/27/2006 | US20060088502 Drug for reducing side effects in ribavirin interferon combination therapy |
| 04/27/2006 | DE4215450B4 Topische Pharmazeutische Mittel und Verfahren zu ihrer Herstellung A topical pharmaceutical means and methods for their preparation |