| Patents for A61K 31 - Medicinal preparations containing organic active ingredients (785,912) |
|---|
| 04/27/2006 | US20060089411 Treatment of Stargardt's disease and other lipofuscin disorders with combined retinaldehyde inhibitor and zeaxanthin |
| 04/27/2006 | US20060089410 Combination of chemotherapeutic drugs for increasing antitumor activity |
| 04/27/2006 | US20060089409 5-Lipoxygenase inhibitor for treating inflammations and hypersensitivity-based human diseases including asthma, arthritis, bowel diseases such as ulcerative colitis and circulatory disorders such as shock and ischaemia; antiinflammatory agent, antitumor agent |
| 04/27/2006 | US20060089408 Method of treating blepharospasm with a prostaglandin derivative |
| 04/27/2006 | US20060089407 Methods for Making and Using Synergistic Multifunctional Compositions |
| 04/27/2006 | US20060089406 Inhibitors of the fatty acid oxidation for the prophylaxis and/or the treatment of chronic and/or atopic skin diseases |
| 04/27/2006 | US20060089405 Asymmetric synthesis of dihydrobenzofuran derivatives |
| 04/27/2006 | US20060089404 Ppar alpha selective compounds for the treatment of dyslipidemia and other lipid disorders |
| 04/27/2006 | US20060089403 thiophene-2,5-dicarboxylic acid 2-[(2-amino-phenyl)-amide]5-octylamide; histone deacetylase inhibitors; anticancer agents; low toxicity; potent antiproliferative and cell differentiation activity; two-step one-pot procedure; activation of carboxylated derivative in inert solvents then amination |
| 04/27/2006 | US20060089402 Compounds from Antrodia camphorata and use thereof |
| 04/27/2006 | US20060089401 Kinase inhibitors |
| 04/27/2006 | US20060089400 Novel spiro ketone and carboxylic acid derivatives as specific inhibitors for (po3h2) ser/(po3h2)thr-pro-specific peptidyl-prolylcis/trans-isomerases |
| 04/27/2006 | US20060089398 Isoxazole carboxamide derivatives as ghrelin receptor modulators |
| 04/27/2006 | US20060089397 Synthetic diazonamides |
| 04/27/2006 | US20060089396 N-(5-Halo-2-thiazolyl)benzamides, e.g., 2-(acetoxy)-3-methyl-N-(5-bromo-2-thiazolyl)benzamide; antiviral agents that are more selective for viral pathogens, and accordingly cause reduced deleterious effects upon beneficial gut microflora when administered orally |
| 04/27/2006 | US20060089395 Nf-kb activation inhibitors |
| 04/27/2006 | US20060089394 {[2-Methyl-4-({[4'-(trifluoromethyl)-3-biphenylyl]methyl}thio)phenyl]oxy}acetic acid; adipogenic signalling cascade and lipid homeostasis; increase High Density Lipoproteins; hypotensive agent; Syndrome X, obesity, insulin resistance, cardiovascular disorder |
| 04/27/2006 | US20060089393 Heteroaryl substituted biphenyl derivatives as p38 kinase inhibitors |
| 04/27/2006 | US20060089392 Ester derivatives and medicinal use thereof |
| 04/27/2006 | US20060089391 Treatment of cancer in pediatric patients |
| 04/27/2006 | US20060089389 Combination |
| 04/27/2006 | US20060089388 Use of parathyroid hormone-related protein (PTHrP) in the diagnosis and treatment of chronic lung disease and other pathologies |
| 04/27/2006 | US20060089387 Stabilized pharmaceutical composition comprising antidiabetic agent |
| 04/27/2006 | US20060089386 Novel process for substituted sulfoxides |
| 04/27/2006 | US20060089385 Pharmaceutical compositions |
| 04/27/2006 | US20060089384 Ophthalmic compositions and methods of using the same |
| 04/27/2006 | US20060089383 Substituted piperidine compounds and methods of their use |
| 04/27/2006 | US20060089382 Substituted 3-cyanoquinolines as mek inhibitors |
| 04/27/2006 | US20060089381 Via liquid chromatography using packing material comprising carrier and polysaccharide, where part or all of hydrogen atoms of hydroxyl and amino groups of polysaccharide are substituted with substituents such as a carbamoyl group where one hydrogen is substituted with aromatic group with specific alkyl |
| 04/27/2006 | US20060089380 Treating nervous system disorders such as mild cognitive impairment, Alzheimer's disease or dementia associated with Down syndrome; e.g. use of 5,7-dichloro-8-hydroxy-2-(2-pyridyl)-quinoline (PBT 1052) |
| 04/27/2006 | US20060089379 Tetrahydropyranyl cyclopentyl tetrahydroisoquinoline modulators of chemokine receptor activity |
| 04/27/2006 | US20060089378 Tetrahydro-pyridinyl pyrazole cannabinoid modulators |
| 04/27/2006 | US20060089377 Tenatoprazole salts and process of preparation thereof |
| 04/27/2006 | US20060089376 Tenatoprazole salts and process of preparation thereof |
| 04/27/2006 | US20060089375 Pyrazolo[3,4-b] pyridine compounds, and their use as phosphodiesterase inhibitors |
| 04/27/2006 | US20060089374 Antidiabetic agents; metabolism disorders; hypotensive agents |
| 04/27/2006 | US20060089373 High potency dopaminergic treatment of neurological impairment associated with brain injury |
| 04/27/2006 | US20060089372 Dihydroimidazo[5,1-a]sg(b)-carboline derivatives, method for preparing same and use thereof as medicine |
| 04/27/2006 | US20060089371 Phenyl or heteroaryl amino alkane derivatives as ip receptor antagonist |
| 04/27/2006 | US20060089369 pyrimidine and pyridine derivatives; diabetes, neurodegenerative disorders, obesity, atherosclerotic cardiovascular disease, hypertension, polycystic ovary syndrome, syndrome X, ischemia, traumatic brain injury, bipolar disorder, immunodeficiency, cancer |
| 04/27/2006 | US20060089368 Phenyl-piperazine derivatives as serotonin reuptake inhibitors |
| 04/27/2006 | US20060089367 New indole or benzimidazole derivatives as CB1 inverse agonists |
| 04/27/2006 | US20060089366 New piperazine and piperidine compounds |
| 04/27/2006 | US20060089365 Heterocyclic compounds useful as nurr-1 activators |
| 04/27/2006 | US20060089364 Arylpiperaszine derivatives, to the process for the production thereof and to the use thereof as therapeutic agents |
| 04/27/2006 | US20060089363 Antibacterial agents |
| 04/27/2006 | US20060089362 N-(2- piperazinophenyl) methyl 3-(3-chlorophenyl)-pyrazolo-[1,5-a]-pyrimidine-6-amide; treats circulatory diseases such as diseases due to inflammation, circulatory disorders, enhanced proliferation activities, and the like, i.e., hypertension, diabetes, diabetic complications, arteriosclerosis |
| 04/27/2006 | US20060089361 Methods for treating retinal diseases |
| 04/27/2006 | US20060089360 Inflammatory or neuropathic pain and diseases involving sensory nerve function such as asthma, rheumatoid arthritis, osteoarthritis, inflammatory bowel disorders, urinary incontinence, migraine and psoriasis; 6-(1H-indol-5-yl)-N-(4-(trifluoromethyl)phenyl)-4-pyrimidinamine |
| 04/27/2006 | US20060089359 For prophylaxis and therapy of cancer |
| 04/27/2006 | US20060089358 5-[(4-aminopiperidin-1-yl)methyl]-N-[(1R)-1-phenylethyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine, BMS-673675 for example; antiproliferative agents; inhibit tyrosine kinase activity of growth factor receptors such as HER1, HER2 and HER4 |
| 04/27/2006 | US20060089357 Novel compounds and compositions as cathepsin inhibitors |
| 04/27/2006 | US20060089356 Substituted imidazoles as cannabinoid receptor modulators |
| 04/27/2006 | US20060089355 Methods of treating alzheimer's disease using aromatically substituted w-amino-alkanoic acid amides and alkanoic acid diamides |
| 04/27/2006 | US20060089354 ligands for receptor localization studies; for inhibiting binding of vanilloid ligand to a capsaicin receptor; Phosphoric acid dibenzyl ester 4-(4-tert-butyl-phenylamino)-7-(3-trifluoromethyl-pyridin-2-yl)-quinazolin-2-ylmethyl ester; to treat neuropathic pain, itch, urinary incontinence, cough, obesity |
| 04/27/2006 | US20060089353 Indole derivative compounds and drugs containing the compounds as the active ingredient |
| 04/27/2006 | US20060089351 Neuropeptide receptor modulators |
| 04/27/2006 | US20060089350 Methods and compositions for the treatment of neuropsychiatric disorders |
| 04/27/2006 | US20060089349 11beta-hydroxysteroid dehydrogenase type 1 active compounds |
| 04/27/2006 | US20060089348 neurokinin-2 and neurokinin-3 antagonists; schizophrenia, COPD, asthma, irritable bowel syndrome; N'-ethyl-3-methyloxy-N',2-diphenyl-4-quinolinecarbohydrazide |
| 04/27/2006 | US20060089347 Substituted azepines as histamine h3 receptor antagonists, preparation and therapeutic uses |
| 04/27/2006 | US20060089346 Optionally fused aryl-substituted azepanones, oxazepanone or thiazepanones substituted with a dipeptide group, e.g., N2-[(3,5-difluorophenyl)acetyl]-N1-[(2R,3R)-2-(2,5-difluorophenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl]-L-alaninamide; secretase inhibitors for treating Alzheimer's disease |
| 04/27/2006 | US20060089345 Indole derivatives, method for preparating same and pharmaceutical compositions containing same |
| 04/27/2006 | US20060089344 E.g., 2-(Methylamino)-2-oxoethyl 3-[1-(1-isoquinolyl)-4-piperidyl]propylcarbamate hydrochloride and 3{2-[1-(2-quinolyl)-4-piperidyl]-ethyl}-1,3-oxazolidine-2,4-dione; preventing or treating a pathology in which endogenous cannabinoids and/or any other substrate metabolized by the enzyme FA; analgesics |
| 04/27/2006 | US20060089343 Superoxide dismutase mimics for the treatment of ocular disorders and diseases |
| 04/27/2006 | US20060089342 polyvalent metal salts of pyrithione; salt of zinc, copper, silver, nickel, cadmium, mercury, and/or bismuth; di- or polyamines, diethylene triamine penta-acetic acid, tetraethylene triamine, ethylene diamine, and/or diethylene triamine strong chelator |
| 04/27/2006 | US20060089341 Protein-bound derivatives of platinum complexes containing cyclobutane1,1-dicarboxyllate ligands |
| 04/27/2006 | US20060089340 Novel steroids and steroid mimetics; method for their production; and use thereof |
| 04/27/2006 | US20060089339 Method of improving cumulative embryo score and quantity of fertilized ooytes, increasing euploidy rate and of normalizing ovarian function using an androgen such as dehydroepiandrosterone |
| 04/27/2006 | US20060089338 Dosage form for hormonal contraception |
| 04/27/2006 | US20060089337 Estrogen replacement regimen |
| 04/27/2006 | US20060089336 4-Dedimethylamino tetracycline compounds |
| 04/27/2006 | US20060089335 Compositions and methods for enhancing cognitive function and synaptic plasticity |
| 04/27/2006 | US20060089334 Aminoalkylphosphonates and related compounds as edg receptor agonists |
| 04/27/2006 | US20060089333 Hyperproliferative disorders; lyophilisates; shelf life; pharmacokinetics |
| 04/27/2006 | US20060089332 prodrugs include enantiomorphs, stereoisomers and isomers as well as solvates and metabolites of 1,2-bis(methylsulfonyl)-2-(2-chloroethyl)hydrazine-carboxylic acid 1-(3-phosphonoxy-4-nitrophenyl)ethyl ester, used as antitumor or anticarcinogenic agents |
| 04/27/2006 | US20060089331 Methods and compositions for reducing toxicity of a pharmaceutical compound |
| 04/27/2006 | US20060089330 Solid-phase and solution-phase synthesis of glycosylphosphatidylinositol glycans |
| 04/27/2006 | US20060089329 Ready-to-use gemcitabine solution concentrates |
| 04/27/2006 | US20060089328 Ready-to-use gemcitabine solutions |
| 04/27/2006 | US20060089327 Combinations comprising epothilones and anti-metabolites |
| 04/27/2006 | US20060089326 Immunostimulatory nucleic acid molecules |
| 04/27/2006 | US20060089325 Antisense modulation of PTP1B expression |
| 04/27/2006 | US20060089322 Antisense oligonucleotides for identifying drug targets and enhancing cancer therapies |
| 04/27/2006 | US20060089320 Modulation of type IIß phosphoinositide phosphate kinase |
| 04/27/2006 | US20060089319 Method for treatment and prevention of bacterial vaginosis |
| 04/27/2006 | US20060089318 Inhibitors of adp-ribosyl transferases, cyclases, and hydrolases |
| 04/27/2006 | US20060089317 Treatment of metastatic breast cancer with anthracyclines, and taxanes |
| 04/27/2006 | US20060089316 Method for reducing a susceptibility to tumor formation induced by 3-deoxyglucosone and precursors thereof |
| 04/27/2006 | US20060089313 Methods and compositions for ameliorating the undesirable effects of chemotherapy |
| 04/27/2006 | US20060089308 Preconditioning human female; pregnancy; administering dehydroisoandrosterone and gonadotrophin |
| 04/27/2006 | US20060089303 Cancer-testis antigens |
| 04/27/2006 | US20060089300 Macrocyclic peptides active against the hepatitis C virus |
| 04/27/2006 | US20060088933 Immunogenic label for detection of low concentrations of viral therapeutics/antibodies in blood; diagnosing/detecion/monitoring viral drug resistance; immunoassay |
| 04/27/2006 | US20060088913 Mutation associated with epilepsy |
| 04/27/2006 | US20060088899 Combination chemotherapy with chlorotoxin |
| 04/27/2006 | US20060088884 Administering brain-derived neurotrophic factor in its native sequence to an oocyte; stimulation of oocyte maturation alleviates an infertility condition |
| 04/27/2006 | US20060088881 Methods and compositions for treating urological disorders using 1435, 559, 34021, 44099, 25278, 641, 260, 55089, 21407, 42032, 46656, 62553, 302, 323, 12303, 985, 13237, 13601, 18926, 318, 2058 or 6351 molecules |
| 04/27/2006 | US20060088880 Methods and compositions for the treatment and diagnosis of cellular proliferation disorders using 25943 |
| 04/27/2006 | US20060088837 Expression system for stem-loop rna molecule having rnai effect |