| Patents for A01P 7 - Arthropodicides (17,023) |
|---|
| 06/01/1982 | CA1124747A1 Substituted n-phenyl-n'-benzoyl-ureas and their use as insecticides |
| 06/01/1982 | CA1124737A1 Process for the preparation of 2,3-dihydro-2,2- dimethyl-7-hydroxybenzofuran |
| 04/06/1982 | US4323556 Solid formulations containing pheromones and method of using same |
| 03/24/1982 | EP0048186A2 Cyclopropane-carboxylic-acid derivatives, their preparation, their use in combating vegetal parasites, animals and locations, their compositions, and intermediates |
| 03/23/1982 | CA1120480A1 N-benzoyl n'-pyridyloxy phenyl urea |
| 03/16/1982 | US4320125 Thiazolylidene-oxo-propionitrile salts and insecticidal compositions containing these salts |
| 03/10/1982 | EP0046950A1 Optically active isomers of trans-3(2-(4-chlorophenyl)-vinyl)-2,2-dimethyl-cyclopropion-1-ic acid-(alpha-cyano-4-fluoro-3-phenoxy-benzyl)-esters, process for their preparation and their use as ectoparasiticides |
| 02/16/1982 | US4315943 Cyclopropyl-carboxylates used as nematocides |
| 01/26/1982 | CA1117005A1 Animal ear-tags, their manufacture and their use |
| 01/20/1982 | EP0044214A2 Novel phosphorous esters of cyanohydrins, pesticidal compositions including same, and methods of controlling pests using same |
| 01/12/1982 | US4310530 N-benzoyl N-pyridyloxy phenyl urea |
| 12/16/1981 | EP0041654A1 Agent with a very strong residual action for combating animal ectoparasites |
| 12/08/1981 | CA1113946A1 Phosphoric and thiophosphoric esters of 5(3)-hydroxypyrazoles having insecticidal properties |
| 12/01/1981 | US4303585 3-Oxa-bicyclo (3,1,0)-hexan-2-one intermediates |
| 12/01/1981 | CA1113477A1 Substituted phenoxybenzyloxycarbonyl derivatives and their use as insecticides and acaricides |
| 11/03/1981 | CA1111760A1 Pesticidal composition |
| 10/27/1981 | US4297361 Preferential activity against beetles, moths, and flies |
| 10/13/1981 | CA1110650A1 Organophosphoric acid esters and their use as insecticides, acaricides and nematocides |
| 10/13/1981 | CA1110622A1 Tetrahydro-s-triazine thiones |
| 10/06/1981 | US4293566 Pesticidally active 1-arylamino-2,4-dinitronaphthalenes |
| 09/08/1981 | USRE30740 Insecticidal composition for ultra low volume application |
| 08/04/1981 | USRE30700 Insecticidal compositions for ultra low volume application |
| 07/21/1981 | US4279920 2,2-Dimethyl-3-(2-bromo-2-phenyl-vinyl)-cyclopropanecarboxylic acid 3-phenoxybenzyl esters and pesticidal use |
| 07/21/1981 | US4279903 Anthelmintics, insecticides |
| 07/07/1981 | CA1104583A1 Cyclohexane derivatives |
| 06/16/1981 | US4273727 (S) α-Cyano-3-phenoxy-benzyl alcohol |
| 06/16/1981 | CA1103251A1 Preparation of benzoylureas |
| 06/10/1981 | EP0030133A1 Carbofuran-containing plant protecting compositions and the preparation thereof |
| 06/09/1981 | CA1102811A1 Thiazolines |
| 05/05/1981 | US4265876 3-phenoxybenzyl 2,2-dimethyl-3-(2,2-dihalovinyl) cyclopropyl carboxylate pesticide |
| 05/05/1981 | CA1100514A1 Imidazolidine derivatives useful as insecticides and acaricides |
| 04/15/1981 | EP0026829A1 Pesticides containing a triazole derivative and a phosphorothioic acid ester and their use in combating harmful insects and acarides |
| 04/14/1981 | US4261921 Cyclic crystallization of stereoisomers from racemic mixture folloed by racemization of mother liquor |
| 04/14/1981 | US4261920 3-Phenoxy-fluoro-benzyl alcohol intermediates |
| 03/18/1981 | EP0025179A1 Process for the preparation of methane-phosphonic acid esters containing propargyl groups |
| 03/17/1981 | US4256902 Forming an alkaline salt by reacting a hydrazine with a b,b-dichloro-acryloyl chloride, acidifying |
| 03/17/1981 | US4256647 Cyclization of o-methallylpyrocatechol in the presence of water |
| 02/10/1981 | US4249937 Cyclohexane derivatives |
| 01/14/1981 | EP0022382A1 Crystalline insecticidal pyrethroid enantiomer pair, process for preparation and composition |
| 01/13/1981 | CA1093570A1 Benzophenone hydrazones |
| 12/23/1980 | CA1092123A1 Diethyl 2-pyridine thionophosphonate as an insecticide activator |
| 12/10/1980 | EP0019946A1 Dihydrothiazine derivatives, their preparation, their inclusion in anthelmintic and pesticidal compositions and their use as anthelmintics and pesticides |
| 12/09/1980 | CA1091244A1 Novel phenol carbamyl methyl thio phosphoric acids as pesticidal agents |
| 12/09/1980 | CA1091237A1 Thiazolylcinnamic acid nitriles, their manufacture and their use as pesticides |
| 11/25/1980 | CA1090250A1 Pesticidally active compounds and their manufacture and use |
| 11/11/1980 | US4233293 Insecticidal and acaricidal O-alkyl-O-[1-(2-cyanoalkyl)-5-halo-1,2,4-triazol(3)yl]-(thiono)(thiol)-phosphoric(phosphonic) acid esters and ester-amides |
| 11/11/1980 | US4233059 1,2,3-Triazole carboxylic acid amides and biocidal compositions containing the same |
| 10/28/1980 | CA1088553A1 Tert.-butyl-substituted pyrazolyl (thiono) (thiol)- phosphoric(phosphonic) acid esters and ester-amides and their use as insecticides, acaricides and nematicides |
| 10/28/1980 | CA1088418A1 Fungicidal mixtures |
| 10/21/1980 | US4229444 Pesticidal O-alkyl-O-(1,5-disubstituted-1,2,4-triazolyl-(3)-thiono-phosphoric (phosphonic) acid esters and ester-amides |
| 10/14/1980 | CA1087620A1 Unsymmetrical bis-carbamate compound |
| 09/30/1980 | CA1086766A1 O-ethyl-s-n-propyl-0,2,2,2- trihaloethylphosphorothiolates (or thionothiolates) |
| 09/30/1980 | CA1086753A1 N-sulphenylated carbamates and their use as pesticides |
| 09/23/1980 | CA1086322A1 6,7 dialkoxy-2,2-dialkyl-3-chromene compounds |
| 09/02/1980 | CA1084921A1 Derivatives of 2-cyclopropylamino-4,6-diamino-s- triazine as insecticides |
| 08/19/1980 | US4218469 Combating arthropods with 3-phenoxy-fluoro-benzyl carboxylic acid esters |
| 08/19/1980 | CA1084053A1 Certain formamidine dithiophosphates and phosphonates and their use as insecticides |
| 07/22/1980 | US4213992 Insecticidal carbamates |
| 07/15/1980 | US4212887 Nematocides, insecticides, miticides, aphidicides |
| 07/15/1980 | US4212861 Isoxazole-5-alkyl dithiophosphoric acid derivatives |
| 07/15/1980 | CA1081615A1 Insecticide activators |
| 07/08/1980 | CA1081247A1 Phosphoric acid amide esters and their use as insecticides, acaricides or nematicides |
| 07/08/1980 | CA1081246A1 O-phenylthionophosphonic acid esters and their use as insecticides, acaricides and nematicides |
| 07/08/1980 | CA1081225A1 (thiono) (thiol) pyridazinone-alkanephosphonic acid esters, and their use as insecticides and acaricides |
| 07/01/1980 | CA1080738A1 Pesticidal compositions |
| 07/01/1980 | CA1080617A1 Pesticides |
| 06/24/1980 | CA1080230A1 0-alkyl-0-(6-substituted-pyridazin-(3)yl)-(thiono) (thiol)alkanephosphonic acid esters |
| 06/11/1980 | EP0012096A1 Process for the preparation of 2,3-dihydro-2,2-dimethyl-7-hydroxy-benzofurane |
| 05/27/1980 | CA1078404A1 Pesticidal alpha-thioamidophenoxybenzyl esters |
| 04/29/1980 | CA1076585A1 Phosphoric acid derivatives |
| 04/29/1980 | CA1076576A1 0-(1-fluoro-2-halo-ethyl) (thiono) phosphoric(phosphonic)acid ester-amides,processes for their preparation and their use as insecticides, acaricides and nematocides |
| 04/22/1980 | CA1076132A1 N,n'-diphenyl-guanidine derivatives |
| 04/16/1980 | EP0009709A1 Fluoro-alkenyl-substituted cyclopropane carboxylic acid esters (I), processes for their production, intermediates obtained thereby and their preparation, compositions containing the esters (I) and the use of the esters (I) in combating insects and/or spiders |
| 04/16/1980 | EP0009708A1 Substituted m-phenoxy-benzyl bromostyryl-cyclopropane carboxylates (I), processes for their preparation, intermediates obtained thereby and their preparation, compositions containing the esters (I), the use of the esters (I) and methods for the production of insecticidal and/or acaricidal compositions |
| 04/01/1980 | CA1074795A1 Process for the preparation of novel phosphorylated thiophenic substances |
| 03/18/1980 | US4193994 Acaricides |
| 03/04/1980 | CA1072965A1 2-substituted 5-trifluoromethyl-1,3,4-thiadiazoles and their use as fungicides and insecticides |
| 02/26/1980 | US4190653 Pesticidally active O-ethyl-S-N-propyl-O-2,2,2-trihaloethyl-phosphoro(thiono)thiolates |
| 02/26/1980 | US4190650 Phosphonyl vinyl phosphorus compounds as pesticides |
| 02/19/1980 | US4189476 Combating pests with O,S-dialkyl-O-haloalkyl-phosphorothiolates |
| 02/05/1980 | CA1071206A1 O, o-di-alkyl-o(1-6-pyridazinon-3-yl)-(thiono)-phosphoric acid esters |
| 01/29/1980 | CA1070706A1 Pyrethroidal pesticides |
| 01/23/1980 | EP0007255A1 Substituted cyclopropane carboxylic acid esters of alpha-cyanated alcohols, a process for their preparation, pesticidal compositions containing them, as well as their use as veterinary medicaments |
| 01/22/1980 | CA1070308A1 1-(substituted benzolyl)-3-(substituted pyrazinyl) ureas |
| 01/15/1980 | US4183949 Pesticidally active 1-arylamino-2,4-dinitronaphthalenes |
| 01/15/1980 | CA1069918A1 Substituted thionophosphonic acid dialkyl esters and their use as insecticides |
| 12/04/1979 | CA1067515A1 N-(substituted phenyl)-n'-benzoyl-ureas and their use as insecticides |
| 11/06/1979 | US4173638 N-Benzoyl-N'-pyridyloxy phenyl urea and insecticidal compositions thereof |
| 10/30/1979 | CA1065345A1 1,3-bis-(tert-butyldithio)-2-dimethylaminopropane |
| 10/23/1979 | CA1064939A1 Oxadiazolinone derivatives |
| 10/23/1979 | CA1064938A1 Organophosphorus compounds useful as insecticides and acaricides |
| 10/16/1979 | US4171357 Pesticides |
| 10/16/1979 | CA1064490A1 Imidazole derivatives |
| 09/18/1979 | US4168304 Combating pests with 4-substituted-pyrimidin-6-yl (thiono)-phosphoric (phosphonic) acid esters or ester amides |
| 09/11/1979 | CA1062271A1 Symmetrical bis-carbamate compounds |
| 09/05/1979 | EP0003913A1 Pesticidally active benzophenone hydrazone derivatives, methods for their production and pesticidal compositions and methods |
| 08/28/1979 | US4166130 1,5-di-(2,4-dimethylphenyl)-3-methyl-1,3,5-triazapenta-1,4 -diene and camphechlor |
| 08/14/1979 | CA1060464A1 Pesticidal triazapentadienes |
| 08/08/1979 | EP0003336A2 Insecticidal perhaloalkylvinylcyclopropanecarboxylates |
| 08/07/1979 | CA1060035A1 Pesticidal compositions |