| Patents for A01P 5 - Nematocides (2,259) |
|---|
| 02/24/1987 | US4645761 Organophosphorus compounds and insecticidal, miticidal, nematicidal or soil pesticidal compositions containing them |
| 02/11/1987 | CN86104380A 13-halomilbemycin derivatives, their preparation and compositions containing them |
| 12/10/1986 | EP0203954A1 Benzofuran derivatives, their preparation and their use as pesticides. |
| 12/03/1986 | EP0203832A1 13-Halomilbemycin derivatives, their preparation and compositions containing them |
| 10/29/1986 | CN85109349A New pesticides |
| 10/22/1986 | CN85109754A Process for the preparation of organophosphorus compounds |
| 07/02/1986 | EP0186124A1 Organophosphorus compounds, process for their preparation and insecticidal, miticidal, nematicidal or soil pesticidal compositions containing them |
| 06/05/1986 | WO1986003202A1 New pesticides |
| 05/10/1983 | US4382957 Miticides, nemotacides |
| 12/14/1982 | CA1137254A1 Stabilisation of soil fumigant compositions consisting of or containing 1,3-dichloropropene |
| 08/10/1982 | CA1129425A1 Biocidally active 1,2,3-triazolecarboxylic acid amides, a process for their manufacture and their use |
| 10/13/1981 | CA1110650A1 Organophosphoric acid esters and their use as insecticides, acaricides and nematocides |
| 07/28/1981 | US4281016 Dithiocarbamates |
| 07/21/1981 | US4279903 Anthelmintics, insecticides |
| 01/13/1981 | CA1093573A1 Amidino-phosphoric acid thiol esters for combating pests |
| 01/13/1981 | CA1093463A1 Pesticides |
| 12/10/1980 | EP0019946A1 Dihydrothiazine derivatives, their preparation, their inclusion in anthelmintic and pesticidal compositions and their use as anthelmintics and pesticides |
| 12/09/1980 | CA1091244A1 Novel phenol carbamyl methyl thio phosphoric acids as pesticidal agents |
| 11/11/1980 | US4233059 1,2,3-Triazole carboxylic acid amides and biocidal compositions containing the same |
| 10/28/1980 | CA1088553A1 Tert.-butyl-substituted pyrazolyl (thiono) (thiol)- phosphoric(phosphonic) acid esters and ester-amides and their use as insecticides, acaricides and nematicides |
| 10/21/1980 | US4229444 Pesticidal O-alkyl-O-(1,5-disubstituted-1,2,4-triazolyl-(3)-thiono-phosphoric (phosphonic) acid esters and ester-amides |
| 10/21/1980 | CA1087865A1 Method of sterilizing male anthers |
| 10/15/1980 | EP0017265A1 A soil fumigant composition comprising 1.3-dichloropropene and a method of stabilising the same |
| 10/14/1980 | CA1087620A1 Unsymmetrical bis-carbamate compound |
| 09/30/1980 | CA1086766A1 O-ethyl-s-n-propyl-0,2,2,2- trihaloethylphosphorothiolates (or thionothiolates) |
| 09/30/1980 | CA1086753A1 N-sulphenylated carbamates and their use as pesticides |
| 07/15/1980 | US4212887 Nematocides, insecticides, miticides, aphidicides |
| 06/24/1980 | CA1080230A1 0-alkyl-0-(6-substituted-pyridazin-(3)yl)-(thiono) (thiol)alkanephosphonic acid esters |
| 04/29/1980 | CA1076576A1 0-(1-fluoro-2-halo-ethyl) (thiono) phosphoric(phosphonic)acid ester-amides,processes for their preparation and their use as insecticides, acaricides and nematocides |
| 04/01/1980 | CA1074795A1 Process for the preparation of novel phosphorylated thiophenic substances |
| 02/26/1980 | US4190653 Pesticidally active O-ethyl-S-N-propyl-O-2,2,2-trihaloethyl-phosphoro(thiono)thiolates |
| 02/19/1980 | US4189476 Combating pests with O,S-dialkyl-O-haloalkyl-phosphorothiolates |
| 09/11/1979 | CA1062271A1 Symmetrical bis-carbamate compounds |
| 07/31/1979 | US4163052 Nematocides, fungicides, arthropodicides |
| 06/26/1979 | US4159324 Combating insects, acarids and nematodes with O-(1-fluoro-2-halo-ethyl)(thiono)phosphoric(phosphonic) acid ester-amides |
| 05/01/1979 | US4152428 Pesticidal agents |
| 04/24/1979 | CA1053237A1 Thiophosphoric acid amides as nematocides, insecticides and acaricides |
| 04/10/1979 | US4148910 Nematicides, arthropodicides |
| 03/20/1979 | CA1050998A2 Triazolyl phosphorothionate and its use for pest control |
| 03/20/1979 | CA1050997A1 O-triazolylthionophosphoric(phosphonic) acid esters and ester-amides |
| 03/06/1979 | CA1050033A1 Triazolylorganophosphorus derivatives |
| 02/20/1979 | US4140768 O-Alkyl-O-[6-substituted-pyridazin(3)yl]-(thiono) (thiol)alkanephosphonic acid esters for combating pests |
| 02/07/1979 | EP0000528A1 Organophosphonic ester compounds, process for their preparation and their utilisation as insecticides, acaricides and nematocides |
| 09/26/1978 | CA1039299A1 Amide phosphorothiolate pesticides |
| 09/12/1978 | US4113876 Sulfonic acid-n-methylamido-n-sulfenyl-n-methyl-carbamic acid esters |
| 09/12/1978 | US4113860 O-alkyl-O-[4-alkylpyrimidin(2)yl]-(thiono)-(thiol) phosphoric (phosphonic) acid esters and insecticidal, acaricidal and nematocidal compositions containing them |
| 09/05/1978 | US4112107 5-Nitrothiazole containing pesticide composition |
| 08/29/1978 | US4110440 Pesticidal organophosphoric acid ester anhydrides |
| 03/28/1978 | US4081535 O-Alkyl-O-[5-chloro-1,2,4-triazol(3)yl]-thiono(thiol)-phosphoric (phosphonic) acid esters and ester-amides |
| 10/11/1977 | US4053594 O-alkyl-O-[4,6-dimethyl-5-chloropyrimidin-(2)-yl]-(thiono) (thiol) phosphoric acid esters |
| 09/13/1977 | US4047930 Method of sterilizing male anthers |
| 07/19/1977 | US4036947 O-Alkyl-N-subustituted-S-halophenoxymethyl-dithiophosphoric acid ester-amides |
| 05/17/1977 | US4023956 Amide phosphorothiolate herbicides |
| 03/29/1977 | US4014998 O-Alkyl-S-(2-(1,1,2-trifluoro-2-chloroethylmercapto)-ethyl)(thiono)(di) thiolphosphoric (phosphonic) acid esters and ester-amides and pesticidal use |
| 03/01/1977 | US4010157 O-alkyl-S-[1,6-dihydro-3-methyl-6-oxo-pyridazin-(1)-ylmethyl](thiono) (di)thiol-phosphoric acid esters and ester-amides |
| 10/12/1976 | US3985874 Insecticide, acaricide, nematocide |
| 09/14/1976 | US3980777 O-alkyl-O-[2-alkylthio-imidazol(4)yl](thiono)-phosphoric(phosphonic) acid esters and ester-amides |
| 04/06/1976 | US3948945 Insecticide, nematocide, miticide |
| 01/20/1976 | US3934026 Combating nematodes with alkanesulfonic acid 2-bromoethyl esters |