| Patents for A01N 57 - Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds (14,545) |
|---|
| 01/26/2011 | CN101953373A Herbicide composition and preparation method and application thereof |
| 01/26/2011 | CN101953372A Composition containing chlorine fluorine ethofenprox and malathion and application thereof |
| 01/26/2011 | CN101953371A Composition containing tetrafluoro ethofenprox and malathion and application thereof |
| 01/26/2011 | CN101463044B Mechanochemical synthesis of ammonium glyphosate preparation |
| 01/25/2011 | CA2469218C High-strength low-viscosity agricultural formulations |
| 01/20/2011 | WO2011008453A2 N-phosphonomethylglycine guanidine derivative salts |
| 01/20/2011 | WO2011008281A1 Agricultural adjuvant compositions, pesticide compositions, and methods for using such compositions |
| 01/20/2011 | WO2011007104A2 Antifungal compounds and use thereof |
| 01/20/2011 | US20110015076 Pesticidal mixtures |
| 01/20/2011 | US20110015071 Agricultural adjuvant compositions, pesticide compositions, and methods for using such compositions |
| 01/20/2011 | CA2766374A1 N-phosphonomethylglycine guanidine derivative salts |
| 01/19/2011 | CN101951764A Herbicide formulation |
| 01/19/2011 | CN101946803A Beet stress-resistant yield and sugar increasing series composite growth regulator and systematic chemical regulation method |
| 01/19/2011 | CN101946796A Insecticidal composition containing flonicamid and profenofos |
| 01/19/2011 | CN101946795A Thiamethoxam- and phoxim-containing insecticidal composition |
| 01/19/2011 | CN101601407B Method for producing glyphosate sylvine aqua with glyphosate mother liquor |
| 01/13/2011 | WO2011005806A1 4- and 5 substituted 1,2,3- triazole moieties with at least one remote polymerizable moiety and polymers thereof |
| 01/13/2011 | WO2011005608A1 Platelet-activating factor receptor antagonists |
| 01/13/2011 | WO2010017924A8 Herbicidal combination comprising dimethoxytriazinyl-substituted difluoromethane sulfonylanilides |
| 01/13/2011 | US20110009269 Herbicidal composition comprising an aminophosphate or aminophosphonate salt and a viscosity reducing agent |
| 01/12/2011 | EP2272369A1 Agent combinations |
| 01/12/2011 | EP2272368A1 Agent combinations |
| 01/12/2011 | EP2272366A2 Herbicide based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and terbuthylazine |
| 01/12/2011 | EP2272365A2 Herbicides based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and sulcotrione |
| 01/12/2011 | EP2272364A2 Herbicide based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and propoxycarbazone-sodium |
| 01/12/2011 | EP2272363A2 Herbicide based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and metolachlor |
| 01/12/2011 | EP2272362A2 Herbicides based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and mesosulfuron |
| 01/12/2011 | EP2272361A2 Herbicides based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and iodosulfuron-methyl-sodium |
| 01/12/2011 | EP2272360A2 Herbicide based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and glyphosate-isopropylammonium |
| 01/12/2011 | EP2272359A2 Herbicides based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and glufosinate-ammonium |
| 01/12/2011 | EP2272358A2 Herbicides based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and foramsulfuron |
| 01/12/2011 | EP2272357A2 Herbicides based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and flurtamone |
| 01/12/2011 | EP2272356A2 Herbicides based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and flufenacet |
| 01/12/2011 | EP2272355A2 Herbicide based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and Fenoxaprop-(P)-ethyl |
| 01/12/2011 | EP2272354A2 Herbicides based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and diflufenican |
| 01/12/2011 | EP2272353A2 Herbicides based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and dicamba |
| 01/12/2011 | EP2272352A2 Herbicide based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and bromoxynil |
| 01/12/2011 | EP2272351A2 Herbicide based on substituted thien-3-yl-sulfonylamino(thio)carbonyl-triazolin(thi)ones and amidosulfuron |
| 01/12/2011 | EP2272342A2 Herbicidal compositions |
| 01/12/2011 | EP2272341A2 Herbizide Zusammensetzungen |
| 01/12/2011 | EP2271212A1 Stabilized oil-in-water emulsions including agriculturally active ingredients |
| 01/12/2011 | CN101941864A Crop drought-resisting and yield-increasing agent |
| 01/06/2011 | WO2011000880A2 Aqueous herbicide concentrate |
| 01/06/2011 | WO2010002836A3 Combinations of derivatized saccharide surfactants and etheramine oxide surfactants as herbicide adjuvants |
| 01/06/2011 | US20110003689 Use of polymeric guanidine derivatives for the control of unwanted microorganisms in crop protection |
| 01/06/2011 | US20110003011 Fungicidal active compound combinations |
| 01/06/2011 | US20110002998 Process for the production of insecticide-modified bead material composed of expandable polystyrene and insecticide-modified moldings obtainable therefrom |
| 01/06/2011 | CA2766992A1 Aqueous herbicide concentrate |
| 01/05/2011 | EP2269460A1 Agent combinations |
| 01/05/2011 | EP2268139A2 Materials having embedded insecticides and additives |
| 01/05/2011 | CN101938907A Herbicidal compositions |
| 01/05/2011 | CN101938901A Improved herbicidal formulation |
| 01/05/2011 | CN101933524A Water suspending agent pesticides containing dursban and buprofezin and preparation method thereof |
| 01/04/2011 | CA2420942C Organophosphorous compositions |
| 12/30/2010 | US20100331185 Herbicidal Compositions of Lithium Glyphosate and Adjuvants |
| 12/30/2010 | US20100331182 Herbicidal concentrate compositions containing glyphosate and dicamba salts |
| 12/29/2010 | WO2010151622A2 Herbicidal concentrate compositions containing glyphosate and dicamba salts |
| 12/29/2010 | EP2266394A1 Non-aqueous agricultural compositions |
| 12/29/2010 | EP1587366B1 Pesticide formulations containing alkoxylated amines |
| 12/29/2010 | CN101932245A Protective layer for plants and trees, the production thereof and use thereof |
| 12/29/2010 | CN101932242A Quinoxalinyl derivatives |
| 12/29/2010 | CN101932236A Herbicidal composition comprising an aminophosphate or aminophosphonate salt and a viscosity reducing agent |
| 12/29/2010 | CN101928298A Method and device for producing N-phosphono methyl glycine |
| 12/29/2010 | CN101926358A Quaternary phosphonium salt pillared layered zirconium phosphate material, and preparation method and application thereof |
| 12/29/2010 | CN101926357A Hot fogging concentrate of binary composition containing emamectin benzoate and dursban, and preparing method thereof |
| 12/29/2010 | CN101926356A Insecticidal composition containing nitenpyram |
| 12/29/2010 | CN101926355A Composite pesticide for preventing and controlling strong-medicament resistance mulberry pyralid |
| 12/29/2010 | CA2765888A1 Herbicidal concentrate compositions containing glyphosate and dicamba salts |
| 12/29/2010 | CA2764917A1 Use of agrochemical mixtures for increasing the health of a plant |
| 12/28/2010 | US7858599 administering daily dose of creatine to the individual wherein the daily dose of creatine range from about 0.35 mg to 3.5 mg per kilogram body weight; and also administering a dose of amantadine to treat nocturia an urogenital disorder |
| 12/23/2010 | WO2010145772A2 Non-aqueous agricultural compositions |
| 12/23/2010 | US20100325757 Fungicidal compositions and their applications in agriculture |
| 12/23/2010 | US20100324123 Glms riboswitches, structure-based compound design with glms riboswitches, and methods and compositions for use of and with glms riboswitches |
| 12/23/2010 | US20100323897 Foamable pesticide compositions |
| 12/23/2010 | US20100323891 Biocide Compositions (I) |
| 12/23/2010 | US20100323889 Herbicidal compounds |
| 12/23/2010 | US20100323887 Mesoionic pesticides |
| 12/23/2010 | CA2762161A1 Non-aqueous agricultural compositions |
| 12/22/2010 | EP2263463A1 Agent combinations |
| 12/22/2010 | EP2263462A1 Agent combinations |
| 12/22/2010 | EP2262370A1 Di-fluoro containing compounds as cysteine protease inhibitors |
| 12/22/2010 | EP2262363A1 Improved herbicidal formulation |
| 12/22/2010 | EP2003964B1 Agrochemical compositions comprising alkylenediol-modified polysiloxanes |
| 12/22/2010 | CN101921154A Fertilizer specially for increasing yield of grapes |
| 12/22/2010 | CN101921153A Red peony root Chinese herbal medicine nutritional fertilizer |
| 12/22/2010 | CN101921145A Hericium erinaceus cultivation material |
| 12/22/2010 | CN101919423A Vegetable medicament for preventing and controlling cabbage aphids |
| 12/22/2010 | CN101919405A Long-acting slow-release seed coating for preventing and curing corn diseases and insect pests |
| 12/22/2010 | CN101919404A Biopesticide and insect preventing and controlling method |
| 12/22/2010 | CN101919403A Pesticide composition of allyl isothiocyanate and phoxim |
| 12/21/2010 | US7855189 N-(2-nitrophenyl)phosphoric acid triamide obtained by reacting anilines or hydrochlorides with POCl3 OR PSCl3 for inhibiting urease-catalysed urea hydrolysis and combining with nitrification inhibitors pyrazole derivatives, a 1H-1,2,4-traizoles, dicyandiamide |
| 12/16/2010 | WO2010144243A1 Fungicidal composition |
| 12/16/2010 | WO2010109198A3 Compositions to combat ectoparasites |
| 12/16/2010 | WO2010095151A3 A novel water dispersible granular composition |
| 12/16/2010 | WO2009121580A3 Materials having embedded insecticides and additives |
| 12/16/2010 | US20100317522 Adjuvants for Agrochemical Applications |
| 12/16/2010 | US20100317521 Herbicide consisting of a glyphosate formulation containing as a surfactant an alkylamine polyethoxylated where the alkyl group is branched in order to reduce substancially the surface tension and improve efficacy |
| 12/16/2010 | CA2763611A1 Fungicidal composition |
| 12/15/2010 | EP2260711A2 Agent combinations |
| 12/15/2010 | EP2260710A1 Agent combinations |