| Patents for A01N 57 - Biocides, pest repellants or attractants, or plant growth regulators containing organic phosphorus compounds (14,545) |
|---|
| 06/03/1980 | US4206227 With a carbamate derivative |
| 06/03/1980 | US4205977 Agent and method for influencing plant growth |
| 06/03/1980 | CA1078730A1 Ultrasonic preparation of suspensions containing fenitrothion or its derivatives |
| 05/28/1980 | EP0011604A1 Triazole carbamates, process for their preparation and their use |
| 05/28/1980 | EP0011363A1 Pyrazole phosphates and phosphonates, preparation thereof and use thereof as insecticides |
| 05/27/1980 | CA1078399A1 Insecticidal active thiophene phosphorous derivatives |
| 05/27/1980 | CA1078104A1 Wood preservative |
| 05/20/1980 | US4203979 Miticides |
| 05/20/1980 | US4203978 Amidino-phosphoric acid thiol esters for combating pests |
| 05/20/1980 | US4203977 Phosphoric acid esters, composition and use |
| 05/20/1980 | US4203932 Insecticides, miticides |
| 05/20/1980 | US4203757 Herbicides, algicides, lubricants |
| 05/20/1980 | US4203756 Method for increasing the sucrose content of growing plants |
| 05/20/1980 | US4203253 Process for increasing oleoresin synthesis in pinus species |
| 05/14/1980 | EP0010891A1 Heterocyclic substituted triazolyl phosphorous compounds, insecticidal compositions containing them and method for controlling insects |
| 05/14/1980 | EP0010872A1 Process for producing alpha-aminophosphonic acids and their peptides and compounds thus obtained |
| 05/14/1980 | EP0010770A1 4-Pyridyl ureas or thioureas substituted in position 2, process for their preparation and plant growth regulants containing them |
| 05/14/1980 | EP0010754A2 1-Phosphorylated 2-phenoxy-alkyl-2-imidazoline derivatives, process for their preparation, compositions containing these derivatives and their application to pest control |
| 05/14/1980 | EP0010612A1 N-iso-propyl-S-(1,6-dihydro-6-(thi)oxo-pyridazin(1)-yl-methyl-thiolphosphoric acid esteramides, process for their preparation and their use as pesticides |
| 05/13/1980 | US4202889 Combating arthropods with O-alkyl-O-(6-alkoxy-2-cyclopropyl-pyrimidin-4-yl)-(thiono)(thiol)-phosphoric (phosphonic) acid esters or ester-amides |
| 05/13/1980 | US4202129 Insect-combatting device |
| 05/13/1980 | CA1077391A1 Control of agricultural pests by controlled release particles |
| 05/06/1980 | US4201733 Pesticides |
| 04/30/1980 | EP0010283A1 Thiol-phosphoric-acid-S-4-nitro-2-trichloromethylphenyl esters, their preparation and their application |
| 04/29/1980 | US4200450 N-Alkyl or alkoxy-N'-substituted hydrocarbyl urea |
| 04/29/1980 | CA1076585A1 Phosphoric acid derivatives |
| 04/29/1980 | CA1076576A1 0-(1-fluoro-2-halo-ethyl) (thiono) phosphoric(phosphonic)acid ester-amides,processes for their preparation and their use as insecticides, acaricides and nematocides |
| 04/29/1980 | CA1076476A1 Process for increasing the power of insecticidal phosphoric esters and new insecticidal compositions |
| 04/22/1980 | US4199593 Combating arthropods with 5-(3,4-methylenedioxybenzyl)-dioxolanes and synergistic compositions therewith |
| 04/22/1980 | US4199345 Postemergence herbicides |
| 04/16/1980 | EP0010067A2 Process for influencing plant growth |
| 04/16/1980 | EP0010066A2 Agent and method for influencing plant growth containing phosphonous acid peptides |
| 04/16/1980 | EP0009871A1 Organic phosphoric acid ester derivatives, a process for preparing the same and fungicidal, insecticidal or miticidal compositions containing the same |
| 04/16/1980 | EP0009620A1 Herbicides and their application to the control of weeds |
| 04/16/1980 | EP0009566A2 2-Cycloalkyl-pyrimidin(5)yl-(thiono)(thiol)-phosphoric (phosphonic)-acid ester or -esteramides, process for their preparation and use as insecticides, acaricides and nematicides |
| 04/15/1980 | CA1075707A1 Vinyl (thiono) (thiol) phosphoric (phosphonic) acid esters, and their use as insecticides, acaricides and nematicides |
| 04/15/1980 | CA1075598A1 Dithiocarbamate fungicide systems of enhanced effectiveness |
| 04/08/1980 | US4197295 Pyrazole phosphates and phosphonates - insecticides |
| 04/08/1980 | US4197254 Derivatives of N-phosphonomethylglycine |
| 04/02/1980 | EP0009348A2 Pesticidally active salts and compositions containing them and processes for their manufacture and use |
| 04/02/1980 | EP0009103A1 N-(O-ethyl-S-n-propyl-(di)thiophosphoryloxy)-naphtalimides, process for their preparation, pesticidal compositions containing them, their preparation and use |
| 04/01/1980 | US4196293 O,O-bis(substituted pyridinyl)phosphonates and phosphonothioates |
| 04/01/1980 | US4195983 Herbicides |
| 04/01/1980 | CA1074795A1 Process for the preparation of novel phosphorylated thiophenic substances |
| 03/25/1980 | US4195082 Combating arthropods with 0-alkyl-0-trifluoromethylsulphonylphenyl-thiono (thiol)-phosphoric acid esters |
| 03/25/1980 | CA1074326A1 Esters |
| 03/19/1980 | EP0009022A1 Processes for preparing D,L-2-amino-4((hydroxy)(methyl)phosphinoyl)-butyric acid and an acetal of an ester of 3-oxopropylmethyl phosphinic acid |
| 03/19/1980 | EP0008852A1 Amide and hydrazide derivatives of N-trifluoracetyl-N-phosphonomethylglycine, herbicidal compositions and their use |
| 03/19/1980 | EP0008762A1 N,N-dimethyl-O-pyrimidinyl-carbamic acid esters, process for their preparation and their use as pesticides |
| 03/11/1980 | US4192829 Insecticides, miticides, nematocides |
| 03/11/1980 | CA1073349A1 Insecticidal compositions which exhibit a synergistic effect |
| 03/05/1980 | EP0008361A1 Halogen-substituted thiophene derivatives and method for their preparation |
| 03/04/1980 | US4191698 Fungicides, insecticides |
| 03/04/1980 | US4191552 Amine salts of substituted N-phosphonomethylureas and their use as plant growth regulators |
| 03/04/1980 | US4191551 Growth retardants |
| 03/04/1980 | CA1072968A1 Phenylcarbamate |
| 02/26/1980 | US4190653 Pesticidally active O-ethyl-S-N-propyl-O-2,2,2-trihaloethyl-phosphoro(thiono)thiolates |
| 02/26/1980 | US4190652 Combating pests with O-phenyl-thionothiolalkanephosphonic acid esters |
| 02/26/1980 | US4190651 Cyclic phosphoric acid amide esters, and an insecticide containing the same as active ingredient |
| 02/26/1980 | US4190650 Phosphonyl vinyl phosphorus compounds as pesticides |
| 02/26/1980 | US4190430 Di-(cyanoalkyl)-β-haloethanephosphonates and dithiophosphonates and use as plant growth regulators |
| 02/26/1980 | CA1072551A1 (thio)phosphoric acid esters and their use as herbicides |
| 02/20/1980 | EP0008158A1 Thio derivatives of N-trifluoroacetyl-N-phosphonomethylglycine and their herbicidal use |
| 02/20/1980 | EP0008098A1 1-Phenyl-3,3-dichloro-2-propenyl-(di)(thio)-phosphoric acid esters, process for their preparation and their use as pesticides |
| 02/19/1980 | US4189476 Combating pests with O,S-dialkyl-O-haloalkyl-phosphorothiolates |
| 02/19/1980 | US4189475 Malthion and o,o-dimethyl s-(4-aza-6-chloro-2-oxo-benzoxazol-3-yl)-methyl thiophosphate |
| 02/19/1980 | CA1072094A1 Salts of phosphonic acids |
| 02/19/1980 | CA1072007A1 Dermal toxicity of solid compositions containing a montmorillonite type of clay and an organophosphorus pesticide |
| 02/12/1980 | US4188383 Combating arthropods with O-alkyl-O-(6-dialkyl-carbamoyloxy-pyrimidin-4-yl)-(thiono)(thiol)-phosphoric (phosphonic) acid esters and ester-amides |
| 02/12/1980 | US4188382 Thiazolinyl (thiazolyl) phosphonamidates and phosphoramidates pesticidal and herbicidal compositions based thereon |
| 02/12/1980 | US4188381 Fungicides hydrazinium phosphites |
| 02/06/1980 | EP0007719A2 Cyanbenzofuran derivatives, processes for their preparation and their use in herbicidal compositions; cyanobenzene, benzodioxepine, benzodioxaphosphepine and benzodioxathiepine derivatives |
| 02/06/1980 | EP0007684A1 Oxazolidinone phosphonates and their use as herbicides |
| 02/06/1980 | EP0007589A1 Insecticide agents comprising carbamate as active ingredient and triazole derivatives as synergists |
| 02/06/1980 | EP0007544A1 Thienyl-dithiophosphoric acid esters, process for their preparation, their use as pesticides, process for their preparation and method for combating pests |
| 02/06/1980 | EP0007501A1 Cyclopropyl-pyrimidine-(4)yl-(thiono)-(thiol) phosphoric (phosphonic) acid esters and ester amides, process for their preparation, pesticides, process for their preparation, their use and method for combating pests |
| 02/06/1980 | EP0007500A1 O-ethyl-S-n-propyl-N-aminomethylidene-thiol phosphoric-acid diester imides, process for preparing them and their use as pesticides |
| 02/06/1980 | EP0007466A1 2-Cyclopropyl-pyrimidin(4)yl-thionophosphonic acid esters, process for their production, their utilisation as insecticides and acaricides, pesticidal compositions containing these compounds and process for the production of the pesticidal compositions |
| 02/05/1980 | CA1071223A1 (thiol)phosphoric acid esters and their use as herbicides |
| 02/05/1980 | CA1071222A1 Phenyl thiol carbanilide derivatives, method for the preparation thereof and use thereof as fungicide for agriculture |
| 02/05/1980 | CA1071206A1 O, o-di-alkyl-o(1-6-pyridazinon-3-yl)-(thiono)-phosphoric acid esters |
| 02/05/1980 | CA1071099A1 Roach bait composition |
| 01/29/1980 | CA1070704A1 Preparation of benzyl and aryl esters of n-phosphonomethylglycines, herbicidal compositions and use thereof |
| 01/29/1980 | CA1070687A1 O-ethyl-s-n-propyl-o-(pyrazolo(1,5-a)-pyrimidin-(2) yl)-thionothiolphosphoric acid esters |
| 01/23/1980 | EP0007211A1 Derivatives of N-trifluoroacetyl-N-phosphonomethylglycinates and the herbicidal use thereof |
| 01/23/1980 | EP0007210A2 Ester derivatives of N-trifluoro-acetyl-N-phosphonomethylglycine and the herbicidal use thereof |
| 01/23/1980 | EP0007053A1 2-Cyclopropyl-pyrimidin(4)yl-(thiono)(thiol)-phosphoric(phosphonic) acid esters, process for preparing them and their use as insecticides and acaricides |
| 01/23/1980 | EP0007020A1 Organic phosphoric-acid esters, process for their preparation, their use, pesticides and their preparation |
| 01/22/1980 | US4185098 (coco-amino)alkyl phosphonate inner salt and n,n-dimethyl-n-(3-lauroylamidopropyl)amine |
| 01/22/1980 | CA1070323A1 N-(alpha-aminoalkylidene) phosphor-and phosphonamidates |
| 01/15/1980 | US4183922 O,S-dialyl O,S-ureidophenyl phosphorothiolates and phosphorodithioates |
| 01/15/1980 | US4183880 Phosphonation of a thiosulfuric acid salt with a dialkyl phosphite |
| 01/15/1980 | CA1069918A1 Substituted thionophosphonic acid dialkyl esters and their use as insecticides |
| 01/15/1980 | CA1069893A1 O-alkyl-o-(7-alkyl-pyrazolo-(1,5-a) pyrimidin-(2)yl) -(thiono)-phosphoric (phosphonic) acid esters and ester-amides |
| 01/08/1980 | US4182771 Synergistic arthropodicidal compositions containing α-substituted-3,4-methylenedioxyph-enylacetonitriles |
| 01/08/1980 | US4182623 Herbicides, plant growth regulators |
| 12/25/1979 | US4180473 Method of transporting metal ions |
| 12/25/1979 | US4180394 Derivatives of N-trifluoroacetyl-N-phosphonomethylglycinates and the herbicidal use thereof |
| 12/12/1979 | EP0005780A1 N,N'-asymmetrically substituted thio-bis-amines, process for their preparation and their use as insecticides, acaricides and nematocides |
| 12/04/1979 | CA1067402A1 Preparation having a depot gas action |