| Patents for A01N 43 - Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds (92,096) |
|---|
| 02/24/1981 | CA1096192A1 Arboricide |
| 02/24/1981 | CA1096191A1 Herbicidal compositions |
| 02/18/1981 | EP0024017A2 N-pyrimidinylmethyl-haloacetanilides, process for their preparation and their use as herbicides; intermediates and their preparation |
| 02/18/1981 | EP0024016A1 Tetrachlorophthalamic acids, process for their preparation and their bactericidal use |
| 02/18/1981 | EP0023961A1 Process for the preparation of sulfur ylide intermediates of insecticidal pyrethroids |
| 02/17/1981 | US4251540 Combating crop damaging fungi with α-(4-biphenylyl)-benzyl-azolium salts |
| 02/17/1981 | US4251536 Rodenticides comprising 6-aminonicotinamide or 6-aminonicotinohydroxamic acid |
| 02/17/1981 | US4251512 Synergistic fungicidal compositions containing 1,2,4-triazole derivatives |
| 02/17/1981 | US4251263 N-substituted, 2-phenoxynicotinamide compounds and the herbicidal use thereof |
| 02/17/1981 | US4251261 2-Chloro-4-trifluoromethyl-5-thiazolecarboxylic acids and derivatives |
| 02/17/1981 | CA1095910A1 Imidazole carboxylic acids and derivatives thereof |
| 02/17/1981 | CA1095735A1 Herbicidal compositions |
| 02/11/1981 | EP0023891A1 Pyridyl-2-oxy-phenyloxime ethers and esters, their preparation and their use as herbicides |
| 02/11/1981 | EP0023849A2 Substituted pentenoic acid, preparation thereof, its application in the preparation of substituted cyclopropane derivatives |
| 02/11/1981 | EP0023793A1 Composition for attracting ambrosia beetles and its use for combatting same |
| 02/11/1981 | EP0023785A2 Quinoxalinyloxyphenoxyalkane carboxylic acid derivatives, their preparation and their use as herbicides |
| 02/11/1981 | EP0023766A1 Phenyliminothiadiazolines, a method for manufacturing them and their application for regulating growth of plants |
| 02/11/1981 | EP0023756A2 Triazol and imidazol derivatives; processes for their preparation, pesticidal compositions containing them and their use; preparation of intermediates |
| 02/11/1981 | EP0023725A1 Diphenyl ether derivatives, process for preparing the same and herbicidal compositions containing the same |
| 02/11/1981 | EP0023651A1 Imidazolyl-enol ethers, process for their preparation and their use as fungicides |
| 02/11/1981 | EP0023637A1 Substituted 2,3-dihydrobenzofurylmethyl-cyclopropanecarboxylic acid esters, process for their preparation, process for combatting parasites, and agents therefor |
| 02/11/1981 | EP0023614A1 Antimycotic compositions containing imidazolylenol ethers, their preparation and their use |
| 02/11/1981 | EP0023539A1 Alkyl esters of 3-(N-1,3,4-thiadiazolyl-2)-amino-alkyl acrylic acid, process for their preparation and their use as plant bactericides |
| 02/10/1981 | USRE30511 Enzyme inhibitor, herbicide, cyclization |
| 02/10/1981 | US4250324 Water-degradable esters and process for the preparation thereof |
| 02/10/1981 | US4250187 4,5-Dichloro-3-organo-1,2-methylenedioxy-benzene arthropodicide synergizing agents |
| 02/10/1981 | US4250185 1-(3,5-Dichlorobenzoyl)-3-phenylpyrazolines and their use as mildewicides |
| 02/10/1981 | US4250179 N,n-disubstituted carbamoyl imidazole metal salt complexes |
| 02/10/1981 | US4249936 Esters of 2-carboxy-3-azabicyclo-(3.1.0)hex-2-ene |
| 02/10/1981 | US4249934 1,2-Alkylene-4-substituted urazole herbicides |
| 02/10/1981 | US4249933 N-ethyl-n-ethyl-bicyclo(2.2.1) hept-2-yl thiocarbamate and a haloacylamide as antagonist; pre- and postemergence herbicides |
| 02/05/1981 | WO1981000187A1 Engineering improved chemical performance in plants |
| 02/04/1981 | EP0023392A2 Diphenyl ether compounds, and herbicidal compositions and processes utilising them |
| 02/04/1981 | EP0023358A1 Process for the preparation of pyridazine derivatives |
| 02/04/1981 | EP0023335A1 N-Hydroxyalkylimidazoline derivatives, a method for their preparation and their application |
| 02/04/1981 | EP0023332A2 Fungicidal thioglycolic acid anilides, process for their preparation and pesticides containing them |
| 02/04/1981 | EP0023307A1 N-(alpha-chloropropionyl)-1,2,3,4-tetrahydroisoquinoline, process for its preparation and its use as antidote in the protection of crop plants against damage by herbicides |
| 02/04/1981 | EP0023286A2 Azolyl-alkenols, process for their preparation and their use as fungicides |
| 02/03/1981 | US4248886 Combating fungi with N-oxalyl-N-phenyl-aminoacids and esters thereof |
| 02/03/1981 | US4248881 Imidazolylethoxymethyl derivatives of pyrazole |
| 02/03/1981 | US4248875 Pyridyl esters and thiolesters of α-substituted unsaturated acids |
| 02/03/1981 | US4248634 Sodium and potassium chlorides, monobasic and dibasic sodium phosphates |
| 02/03/1981 | US4248620 Fungicidal and herbicidal 5-haloaminoalkylimino-1,3-imidazolidine-2,4-diones |
| 02/03/1981 | US4248619 Bis[pyrimidyloxy(thio)]benzene derivatives |
| 02/03/1981 | US4248618 Derivatives of (pyrimidyloxy)phenoxy-alkanecarboxylic acid and herbicidal compositions thereof |
| 02/03/1981 | CA1095054A1 .beta.-AZOLYLKETONES |
| 02/03/1981 | CA1095052A1 .alpha.,.alpha.-PHENYL-ISOPROPYLACETIC ACID .alpha.-CYANO-3'- PYRIDYL-2'-OXYBENZYL ESTERS |
| 02/03/1981 | CA1095049A1 1-aryl-4-pyridones |
| 02/03/1981 | CA1095043A1 Pentadienone hydrazone derivatives as insecticides |
| 02/03/1981 | CA1095042A1 Heterocyclic phenyl ethers and herbicides containing same |
| 02/03/1981 | CA1094844A1 Use of pyridyl phthalimides as plant growth regulants |
| 02/03/1981 | CA1094843A1 Use of pyridyl phthalamic acids as plant growth regulants |
| 02/03/1981 | CA1094842A1 Wild oat herbicide |
| 02/03/1981 | CA1094841A1 Use of benzothiazoline compounds as plant growth regulants |
| 01/28/1981 | EP0023100A1 Herbicidal compositions comprising a diphenyl ether compound in admixture with another herbicide |
| 01/28/1981 | EP0022975A1 Triazolyl-alkene derivatives, process for their preparation and their use as fungicides |
| 01/28/1981 | EP0022964A2 Nikkomycines, process for their preparation, and their use as a pesticidal agent |
| 01/28/1981 | EP0022910A1 Microbiological processes for the preparation of 1R;3S;5S;alpha R;3-(2-(3,5-dimethyl-2-oxocyclohexyl)-2-hydroxyethyl)2,6-piperidindione, its use and the microorganisms used in producing it |
| 01/27/1981 | US4247560 6,7-Methylenedioxy-isochromane arthropodicide synergizing agents |
| 01/27/1981 | CA1094558A1 Pyrimidyloxy-phenoxy-alkanecarboxylic acids |
| 01/22/1981 | WO1981000038A1 Control of parasitic mites |
| 01/21/1981 | EP0022748A1 Pyridine derivatives, process for their preparation, compositions containing them and their use to combat pests |
| 01/21/1981 | EP0022666A1 Pesticide compositions which contain a surface-active agent and method of applying them to plants |
| 01/21/1981 | EP0022653A1 Novel urea derivatives, arthropod repellent compositions containing them and their use for repelling arthropods |
| 01/21/1981 | EP0022551A1 2-Dihalogenmethylen-3-halogen-3-carboalkoxy-5-oxopyrrolidines, process for their preparation and their use as fungicides, bactericides and algicides |
| 01/21/1981 | EP0022531A1 1-(2,4-Dichlorophenyl)-1-(2,6-dihalogenobenzylmercapto)-2-(1,2,4-triazol-1-yl)-ethanes, process for their preparation and their use as fungicides |
| 01/21/1981 | EP0022511A2 O-Pyrimidinyl esters of N,N-dimethyl carbamic acid, a process for their preparation and their use as parasiticides |
| 01/20/1981 | US4246419 Herbicidal compounds |
| 01/20/1981 | US4246279 Novel dichloromaleic acid diamide derivatives and their use as fungicides |
| 01/20/1981 | US4246276 Combating pests with 2,2-difluoro-5-(2,4-dinitro-6-trifluoromethylphenylamino)-benzodioxoles |
| 01/20/1981 | US4246266 Antimicrobial pyridthiones |
| 01/20/1981 | US4246201 Antiulcer of antispasmodic agents |
| 01/20/1981 | US4246021 Imidazole derivatives |
| 01/20/1981 | US4246020 Imidazole and triazole compounds, fungicidal and plant growth regulating compositions, method of combating fungal infections in plants and method of regulating plant growth |
| 01/20/1981 | CA1094079A1 Triazole derivatives |
| 01/20/1981 | CA1094076A1 3,5-dichloro-2-pyridyloxy-alkanoic acid derivatives |
| 01/20/1981 | CA1093959A1 Parasticide for control of harmful microorganisms |
| 01/14/1981 | EP0022353A1 Derivatives of 2-thioxo-3-benzothiazoline acetonitrile, process for their preparation and their use as leguminous plant growth regulants |
| 01/14/1981 | EP0022288A2 Method of sterilizing male anthers in plants, compositions and compounds suitable for use in such a method, and method of producing F1 hybrid seed |
| 01/13/1981 | US4245106 Process for the preparation of 1-alkyl-3-aryl-4-pyrazolecarboxylates |
| 01/13/1981 | US4245101 Plant growth control agent |
| 01/13/1981 | US4244959 Fungicidal O-acyl (alpha-nitro-formaldoxime) and (alpha-halo-formaldoxime)-pyridines |
| 01/13/1981 | US4244730 Herbicidal N-haloacetyl-2-alkyl-6-acylanilines |
| 01/13/1981 | CA1093570A1 Benzophenone hydrazones |
| 01/13/1981 | CA1093562A1 Imidazole derivatives |
| 01/13/1981 | CA1093561A1 Substituted benzimidazole compounds and use as herbicides |
| 01/13/1981 | CA1093463A1 Pesticides |
| 01/07/1981 | EP0022086A1 4-Oxa-6-aza-6(phenyl)-spiro(2.4)heptane-5,7-diones, preparation and use as microbicides |
| 01/07/1981 | EP0021939A1 Hydrazino (or azido) 5-alkylthio pyrimidines, processes for their preparation and their uses as herbicides and fongicides |
| 01/07/1981 | EP0021827A1 Polyalkylhydroxychromene and process for preparing the same |
| 01/07/1981 | EP0021759A1 5-Substituted oxazolidines having herbicide antidote activity, production thereof, herbicidal compositions containing them, use thereof in preventing injury to crops and crop seeds coated therewith |
| 01/07/1981 | EP0021613A1 Pyridine derivatives, processes for preparing them, herbicidal compositions containing them and methods of killing plants therewith |
| 01/07/1981 | EP0021506A2 New pyrazoline derivatives, method of preparing the new compounds, as well as insecticidal composition on the basis of these new compounds |
| 01/07/1981 | EP0021453A2 2-Chloro-5-trichloromethylpyridine |
| 01/07/1981 | EP0021377A1 1,2,4-Triazole derivatives, process for their preparation and their use as pesticides |
| 01/07/1981 | EP0021345A1 Alpha-azolylglycol derivatives, their preparation, plant growth regulating agents containing them, and their use |
| 01/07/1981 | EP0021327A1 Beta-triazolyl ethers, their preparation, fungicides containing them, process for combating fungi and for producing fungicides |
| 01/07/1981 | EP0021076A1 Process for regulating plant growth |
| 01/07/1981 | EP0020968A1 N,O-acetals of glycolic aldehyde, their preparation and their use as fungicides |
| 01/07/1981 | EP0020859A1 Substituted N-allyl acetanilides, process for their preparation and their use as fungicides |