| Patents for A01N 37 - Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids (35,269) |
|---|
| 09/21/1988 | EP0283457A2 Process for improving the organoleptic properties of wines |
| 09/21/1988 | EP0283261A2 Herbicidal substituted cyclic diones |
| 09/21/1988 | EP0283152A2 Process for the preparation of substituted cyclohexane-1,3,5-triones |
| 09/21/1988 | CN88102052A Fungicide compositions |
| 09/20/1988 | US4772633 6-pyridyl- and 6-phenyl-3-phenyl-1-hexenes and -1-hexynes, composition containing them, and insecticidal and acaricidal method of using them |
| 09/20/1988 | US4772314 Phenylglycines, monomeric |
| 09/20/1988 | US4771571 Method for treating pineapple to prevent pineapple fruit diseases |
| 09/14/1988 | EP0281908A1 Insect and mite repellents |
| 09/14/1988 | EP0281645A1 Antimicrobial cation exchange composition |
| 09/14/1988 | CN88101138A Plant growth regulant |
| 09/13/1988 | US4771131 Cloning and expression of Bacillus thuringiensis toxin gene encoding a protein toxic to beetles of the order Coleoptera |
| 09/13/1988 | US4770878 Mold and dust inhibiting product and method |
| 09/13/1988 | US4770695 N-substituted phenyl tetrahydrophthalimide compounds, and their production and herbicidal use |
| 09/13/1988 | CA1241966A1 1-methylamino-cyclopropane-1-carboxylic acid derivatives |
| 09/07/1988 | WO1988005992A3 Preparation to improve the keeping qualities of foodstuffs, drugs and cosmetic products |
| 09/07/1988 | EP0281521A2 Herbicidal compositions |
| 09/07/1988 | EP0281120A2 Plant growth regulant |
| 09/07/1988 | EP0280697A1 Antiseptic composition incorporating essential oils. |
| 09/07/1988 | CN88100995A Glycine compounds and process for preparing them |
| 09/06/1988 | US4769484 Phenoxybenzoic acid ester herbicides |
| 09/06/1988 | CA1241550A1 Grass seed head suppression process |
| 08/31/1988 | EP0280443A2 Improvements in or relating to repellent compositions |
| 08/31/1988 | EP0280367A2 Glycine compounds |
| 08/31/1988 | EP0280348A1 Fungicidal compositions |
| 08/31/1988 | EP0280185A2 Substituted crotonic acid esters and fungicides containing them |
| 08/31/1988 | CN87100162A Mite-killing pesticide |
| 08/30/1988 | US4767879 Compounds and compositions |
| 08/30/1988 | US4767788 Glutaric acid virucidal processes and compositions |
| 08/30/1988 | US4767782 Propargyl cinnamates, their preparation and their use for controlling pests |
| 08/30/1988 | US4767448 Stabilized mixture of phenmedipham and desmedipham with surfactant, mineral and vegetable oils and carboxylic ester of an alcohol |
| 08/25/1988 | WO1988005992A2 Preparation to improve the keeping qualities of foodstuffs, drugs and cosmetic products |
| 08/24/1988 | EP0279523A2 Licidal compositions containing carboxylic acids |
| 08/24/1988 | EP0279201A2 Process for the preparation of 2-cyano-2-oximino-acetamide derivatives |
| 08/24/1988 | CN88100537A 2-(2, 2-difluorocyclopropyl)-alkylester, process of prepn. and use as insecticide and acaricide |
| 08/23/1988 | US4765825 Particularly effective as preemergence herbicides for grasses |
| 08/18/1988 | DE3704100A1 Acylaminonitriles, their preparation and their use as biocides |
| 08/18/1988 | DE3704004A1 Zubereitung zur verlaengerung der haltbarkeit von lebensmitteln, arzneimitteln und kosmetischen produkten Preparation for extending the shelf life of foods, medicinal and cosmetic products |
| 08/17/1988 | EP0278907A1 Cyclohexane diones |
| 08/17/1988 | EP0278742A2 Cyclic diones |
| 08/17/1988 | EP0278595A2 Fungicides |
| 08/17/1988 | EP0278337A1 Agents to control plant-mites on the basis of azomethines of 2,3-diaminomaleic-acid nitrile |
| 08/17/1988 | EP0144417B1 Composition of matter containing cinnamaldehyde and parabens |
| 08/16/1988 | US4764534 Anticoccidial naphthalenamines and combinations thereof |
| 08/16/1988 | US4764526 Fungicides, parasiticides |
| 08/16/1988 | US4764418 Tissue paper with carboxylic acid; softness, multilayer |
| 08/16/1988 | US4764366 Persistent attractants for the mediteranean fruit fly, the method of preparation and method of use |
| 08/16/1988 | US4764214 Wood preservatives containing 2-iodobenzanilide |
| 08/16/1988 | US4764201 Plant growth regulation |
| 08/16/1988 | CA1240705A1 Optically active n-(1'-methyl-2'-methoxyethyl)-n- chloro-2,6-dimethyl-aniline as herbicide |
| 08/11/1988 | WO1988005630A1 Fungicidal compositions |
| 08/10/1988 | EP0277908A2 2-(2,2-Difluorocyclopropyl)-alkylester, process of preparation and use as insecticide and acaricide |
| 08/10/1988 | CN87107479A Herbicidal compositions based on a glyphosate type herbicide and a phenoxybenzoic type herbicide and method for the treatment of undesirable plants using these compositions |
| 08/09/1988 | US4762551 Herbicides |
| 08/03/1988 | EP0276947A2 Carboxylic acid derivatives |
| 08/03/1988 | EP0276721A1 2-Cyano-2-oximino-acetamides |
| 08/03/1988 | EP0276558A2 Insecticidal ethers |
| 08/02/1988 | US4761486 Cyclohexenone derivatives, the preparation and use thereof as herbicides and plant growth regulators |
| 08/02/1988 | US4761427 Liquid antimicrobial composition |
| 08/02/1988 | US4761280 Additives useful as crystallization inhibitors and activity extenders for trimedlure, the mediterranean fruit fly attractant |
| 08/02/1988 | US4761176 Preemergence herbicides |
| 08/02/1988 | US4761172 Pre- and postemergence |
| 07/27/1988 | EP0275709A1 Method for treating pineapple to prevent pineapple fruit diseases |
| 07/27/1988 | EP0275556A2 Herbicidal composition |
| 07/27/1988 | EP0275555A2 Herbicidal composition |
| 07/26/1988 | US4760192 Herbicidal cyclohexane-1,3-dione derivatives |
| 07/26/1988 | US4760091 Applying fungicidally effective amount of an ornithine decarboxylase inhibitor |
| 07/26/1988 | US4759796 Used together with a carrier and other adjuvant |
| 07/26/1988 | US4759789 Treating locus of plant before or during application of herbicide with oxime ether compound |
| 07/20/1988 | EP0275131A1 Herbicidal oxoindanes and tetrahydronaphthalenes |
| 07/20/1988 | EP0275085A2 Method and composition for repelling insects |
| 07/20/1988 | EP0274717A2 Plant male sterilant |
| 07/20/1988 | EP0274574A2 Composition and method for repelling insects |
| 07/20/1988 | EP0274546A1 New oxazolinone compounds useful as intermediates for the preparation of insecticidal and acaracidal cinnamide compounds |
| 07/13/1988 | CN87106917A Halogencyclopropyl compound, process of preparation and use as herbicide thereof |
| 07/13/1988 | CN87104095A Certain 2-phenylacetyl-1,3,5-cyclohexanetriones |
| 07/12/1988 | CA1239148A1 Derivatives of phenylacetic ester, a process for producing the same and insecticidal compositions containing the same as an active ingredient |
| 07/06/1988 | EP0273549A1 Insecticidal thioethers and derivatives thereof |
| 07/06/1988 | EP0273432A2 2-Nitro-5-(substituted phenoxy) benzohydroximate derivatives and their use as herbicide |
| 07/06/1988 | CN87103552A Use of malonic acid derivative compounds for increasing crop yield |
| 07/05/1988 | US4755218 Reducing acetochlor injury to corn by applying with antidote |
| 07/05/1988 | CA1238922A1 Process for the preparation of benzamidine derivatives having an antimicrobial activity |
| 06/30/1988 | DE3643656A1 Plant defoliant |
| 06/29/1988 | EP0272742A1 Method for preparation of mercaptobenzoates |
| 06/29/1988 | CN86108548A Plant growth promotion |
| 06/28/1988 | US4753934 Acrylic acid heterocyclic amides, fungicidal compositions and use |
| 06/21/1988 | US4752321 Benzoylaminomethylpyrazoles and -furans, composition containing them, and fungicidal and plant growth regulating method of using them |
| 06/16/1988 | DE3642372A1 Herbicidal succinic acid derivatives |
| 06/15/1988 | EP0271240A2 Fluorobenzyl esters |
| 06/15/1988 | EP0270971A2 Substituted benzamides |
| 06/15/1988 | EP0270830A1 Method for regulating plant growth using polysubstituted butyric acids, esters and derivatives thereof |
| 06/15/1988 | EP0270701A1 Plant growth promotion |
| 06/08/1988 | EP0270252A2 Derivatives of propenoic acids used in agriculture |
| 06/08/1988 | EP0270002A2 Cyclohexenone derivatives |
| 06/08/1988 | EP0269837A2 Process for the preparation of 3-sulfenylmaleimides and their use |
| 06/08/1988 | EP0269656A1 Novel malonic acid derivative compounds and compositions thereof for retarding plant growth. |
| 06/08/1988 | EP0162055A4 Fruit fly attractants and baits. |
| 06/07/1988 | US4749812 N-(3-chloro-4-isopropylphenyl) carboxamide derivative and selective herbicide |
| 06/02/1988 | WO1988003794A1 Agent for external treatment of domestic animals |
| 06/01/1988 | EP0268873A2 Cleaner with a disinfecting activity |
| 06/01/1988 | EP0268797A2 Halogencyclopropyl compounds, their preparation and herbicidal application |